CAS 56387-08-7
:2-Amino-3-thiophenecarboxylic acid
Description:
2-Amino-3-thiophenecarboxylic acid, with the CAS number 56387-08-7, is an organic compound characterized by the presence of both an amino group (-NH2) and a carboxylic acid group (-COOH) attached to a thiophene ring. This compound typically exhibits properties associated with both amino acids and heterocyclic compounds. It is a white to off-white solid that is soluble in polar solvents, such as water and alcohols, due to its functional groups. The presence of the thiophene ring imparts unique electronic properties, making it of interest in various fields, including pharmaceuticals and materials science. The compound may exhibit biological activity, potentially acting as an intermediate in the synthesis of more complex molecules or as a ligand in coordination chemistry. Its reactivity is influenced by the amino and carboxylic acid functionalities, allowing for various chemical transformations. Overall, 2-Amino-3-thiophenecarboxylic acid serves as a valuable building block in organic synthesis and research applications.
Formula:C5H5NO2S
InChI:InChI=1S/C5H5NO2S/c6-4-3(5(7)8)1-2-9-4/h1-2H,6H2,(H,7,8)
InChI key:InChIKey=OHMLBZKIUZTEOC-UHFFFAOYSA-N
SMILES:C(O)(=O)C1=C(N)SC=C1
Synonyms:- 2-Amino-3-thiophenecarboxylicacid
- 2-Aminothiophene-3-Carboxylic Acid
- 3-Thiophenecarboxylic acid, 2-amino-
- 3-Thiophenecarboxylicacid, 2-Amino-
- 2-Amino-3-thiophenecarboxylic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
3-Thiophenecarboxylicacid,2-amino-(9CI)
CAS:Formula:C5H5NO2SPurity:97%Color and Shape:SolidMolecular weight:143.16372-Aminothiophene-3-carboxylic acid
CAS:2-Aminothiophene-3-carboxylic acid
Molecular weight:143.1637g/mol2-Aminothiophene-3-carboxylic Acid
CAS:Formula:C5H5NO2SPurity:97%Color and Shape:SolidMolecular weight:143.162-Aminothiophene-3-carboxylic acid
CAS:2-Aminothiophene-3-carboxylic acid is a chemical compound that inhibits histamine release in vivo and has been shown to have an antihistaminic activity. It binds to the histamine H1 receptor, thereby preventing the binding of histamine to the receptor. 2-Aminothiophene-3-carboxylic acid inhibits tumor growth by inhibiting the synthesis of proteins and growth factors in cancer cells. This drug also has shown potential for the treatment of prostate cancer. 2-Aminothiophene-3-carboxylic acid is a molecule that comprises an anthranilic group on one end and a methylene group on the other end. This drug has been shown to inhibit protein synthesis in tumor cells through molecular modelling studies.
Formula:C5H5NO2SPurity:Min. 95 Area-%Color and Shape:PowderMolecular weight:143.16 g/molRef: 3D-FA147485
Discontinued product




