CAS 56396-12-4: Tetrakistrimethylphenylporphin
Description:Tetrakistrimethylphenylporphin, with the CAS number 56396-12-4, is a synthetic porphyrin compound characterized by its complex macrocyclic structure, which includes a central metal ion that can vary depending on the specific derivative. This compound features four trimethylphenyl substituents attached to the porphyrin ring, enhancing its solubility and stability in organic solvents. Tetrakistrimethylphenylporphin exhibits strong light-absorbing properties, making it useful in various applications, including photodynamic therapy, solar energy conversion, and as a dye in organic electronics. Its electronic properties are influenced by the substituents, which can modulate the compound's redox behavior and photophysical characteristics. Additionally, this porphyrin derivative can participate in coordination chemistry, forming complexes with transition metals, which can further alter its reactivity and functionality. Overall, tetrakistrimethylphenylporphin is a versatile compound with significant implications in materials science and biochemistry.
Formula:C56H54N4
InChI:InChI=1/C56H54N4/c1-29-21-33(5)49(34(6)22-29)53-41-13-15-43(57-41)54(50-35(7)23-30(2)24-36(50)8)45-17-19-47(59-45)56(52-39(11)27-32(4)28-40(52)12)48-20-18-46(60-48)55(44-16-14-42(53)58-44)51-37(9)25-31(3)26-38(51)10/h13-28,57,60H,1-12H3/b53-41+,53-42+,54-43+,54-45+,55-44+,55-46+,56-47+,56-48+
- Synonyms:
- 5,10,15,20-Tetrakis(2,4,6-trimethylphenyl)-21H,23H-porphin
- 5,10,15,20-Tetrakis(2,4,6-trimethylphenyl)-21H,23H-porphine
- (1Z,4Z,9Z,15Z)-5,10,15,20-tetrakis(2,4,6-trimethylphenyl)-21,23-dihydroporphyrin