CAS 56396-35-1
:2-Cyano-3-(1-phenyl-1H-indol-3-yl)-2-propenoic acid
Description:
2-Cyano-3-(1-phenyl-1H-indol-3-yl)-2-propenoic acid, identified by its CAS number 56396-35-1, is an organic compound characterized by its unique structure that includes a cyano group, an indole moiety, and a propenoic acid framework. This compound typically exhibits properties associated with both aromatic and unsaturated systems, which may contribute to its reactivity and potential biological activity. The presence of the cyano group suggests it may participate in nucleophilic addition reactions, while the indole structure can impart significant stability and influence its electronic properties. Additionally, the propenoic acid component indicates potential for further chemical modifications, such as esterification or amidation. The compound may also exhibit interesting optical properties due to its conjugated system, making it a candidate for applications in organic electronics or as a dye. Overall, 2-Cyano-3-(1-phenyl-1H-indol-3-yl)-2-propenoic acid is a versatile compound with potential implications in various fields, including medicinal chemistry and materials science.
Formula:C18H12N2O2
InChI:InChI=1S/C18H12N2O2/c19-11-13(18(21)22)10-14-12-20(15-6-2-1-3-7-15)17-9-5-4-8-16(14)17/h1-10,12H,(H,21,22)
InChI key:InChIKey=BIZNHCWFGNKBBZ-UHFFFAOYSA-N
SMILES:C(=C(C(O)=O)C#N)C1=CN(C=2C1=CC=CC2)C3=CC=CC=C3
Synonyms:- 2-Propenoic acid, 2-cyano-3-(1-phenyl-1H-indol-3-yl)-
- 2-Cyano-3-(1-phenyl-1H-indol-3-yl)-acrylic acid
- PF 1005023
- 2-Cyano-3-(1-phenyl-1H-indol-3-yl)-2-propenoic acid
- (E)-2-cyano-3-(1-phenyl-1H-indol-3-yl)acrylic acid
- 2-Cyano-3-(1-phenyl-1H-indol-3-yl)-2-propenoicacid
- UK 5099
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 7 products.
2-Cyano-3-(1-Phenyl-1H-Indol-3-Yl)Acrylic Acid
CAS:2-Cyano-3-(1-Phenyl-1H-Indol-3-Yl)Acrylic AcidPurity:99%Molecular weight:288.3g/molUK-5099
CAS:Formula:C18H12N2O2Purity:>95.0%(HPLC)(qNMR)Color and Shape:White to Yellow powder to crystalMolecular weight:288.31UK-5099
CAS:Formula:C18H12N2O2Purity:≥ 98.0%Color and Shape:Yellow to light brown powderMolecular weight:288.30UK-5099
CAS:UK-5099 (PF-1005023) is a potent MPC inhibitor with an IC50 of 50 nM in rat heart mitochondria.Formula:C18H12N2O2Purity:97.39% - >99.99%Color and Shape:SolidMolecular weight:288.3Ref: TM-T4441
1mg34.00€5mg64.00€10mg93.00€25mg165.00€50mg266.00€100mg404.00€500mg888.00€1mL*10mM (DMSO)73.00€UK 5099
CAS:Specific inhibitor of the mitochondrial pyruvate carrier complexes MPC1 and MPC2. The compound blocks the pyruvate transport across the inner mitochondrial membrane and therefore reduces pyruvate influx into the gluconeogenesis. It supresses glucose production in hepatocytes and was proposed for the control of hyperglycaemia in diabetic patients. Also used for the sensitisation of cancer cell lines to chemotherapy.Formula:C18H12N2O2Purity:Min. 95%Color and Shape:Off-White Yellow PowderMolecular weight:288.3 g/mol





