CAS 564-57-8
:(9xi,11beta)-9-fluoro-11,17-dihydroxy-3,20-dioxopregna-4,6-dien-21-yl acetate
Description:
The chemical substance known as "(9xi,11beta)-9-fluoro-11,17-dihydroxy-3,20-dioxopregna-4,6-dien-21-yl acetate," with the CAS number 564-57-8, is a synthetic corticosteroid. It exhibits anti-inflammatory and immunosuppressive properties, making it useful in various medical applications, particularly in the treatment of conditions such as asthma, allergies, and autoimmune disorders. The structure of this compound features a fluorine atom, which enhances its potency and stability compared to other corticosteroids. It also contains multiple hydroxyl groups, contributing to its biological activity and solubility. The acetate moiety in its structure allows for improved absorption and bioavailability. As a corticosteroid, it functions by modulating gene expression and inhibiting the release of inflammatory mediators, thereby reducing inflammation and immune responses. Due to its pharmacological effects, it is essential to use this compound under medical supervision to manage potential side effects and ensure appropriate dosing.
Formula:C23H29FO6
InChI:InChI=1/C23H29FO6/c1-13(25)30-12-19(28)22(29)9-7-16-17-5-4-14-10-15(26)6-8-20(14,2)23(17,24)18(27)11-21(16,22)3/h4-5,10,16-18,27,29H,6-9,11-12H2,1-3H3/t16-,17-,18-,20-,21-,22-,23?/m0/s1
SMILES:CC(=O)OCC(=O)[C@]1(CC[C@H]2[C@@H]3C=CC4=CC(=O)CC[C@]4(C)C3([C@H](C[C@]12C)O)F)O
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
