CAS 56409-10-0

N-chloro-N-nitrotricyclo[3.3.1.1~3,7~]decan-1-amine

Description:

N-chloro-N-nitrotricyclo[3.3.1.1^3,7]decan-1-amine is a chemical compound characterized by its unique tricyclic structure, which consists of a bicyclic framework with an additional cyclopropane ring. This compound features both a chloro and a nitro functional group attached to the nitrogen atom, contributing to its reactivity and potential applications in various chemical processes. The presence of these functional groups suggests that it may exhibit properties such as being a potential electrophile or a reactive intermediate in organic synthesis. The tricyclic nature of the compound may also impart rigidity to its structure, influencing its physical properties, such as solubility and melting point. Additionally, the compound's CAS number, 56409-10-0, allows for easy identification and reference in chemical databases. Overall, N-chloro-N-nitrotricyclo[3.3.1.1^3,7]decan-1-amine is of interest in the field of synthetic chemistry and may have implications in the development of new materials or pharmaceuticals.

Formula: C₁₀H₁₅ClN₂O₂

InChI: InChI=1/C10H15ClN2O2/c11-12(13(14)15)10-4-7-1-8(5-10)3-9(2-7)6-10/h7-9H,1-6H2

N-Chloro-N-nitroadamantan-1-Amine

CAS: 56409-10-0

Formula: C₁₀H₁₅ClN₂O₂

Molecular weight: 230.69

Ref: 4Z-A-331066