CymitQuimica logo

CAS 56409-44-0

:

5-(Ethylthio)-1,2,4-thiadiazol-3(2H)-one

Description:
5-(Ethylthio)-1,2,4-thiadiazol-3(2H)-one is a heterocyclic compound characterized by its thiadiazole ring structure, which contains sulfur and nitrogen atoms. This compound typically exhibits properties associated with thiadiazoles, such as potential biological activity and the ability to act as a building block in organic synthesis. The presence of the ethylthio group enhances its solubility and may influence its reactivity and interaction with biological targets. It is often studied for its potential applications in pharmaceuticals, agrochemicals, and as a precursor in the synthesis of other organic compounds. The compound's molecular structure contributes to its unique chemical properties, including its stability under various conditions and its reactivity with electrophiles or nucleophiles. As with many thiadiazole derivatives, it may exhibit antimicrobial, antifungal, or herbicidal activities, making it of interest in medicinal and agricultural chemistry. Safety and handling precautions should be observed, as with any chemical substance, due to potential toxicity or reactivity.
Formula:C4H6N2OS2
InChI:InChI=1S/C4H6N2OS2/c1-2-8-4-5-3(7)6-9-4/h2H2,1H3,(H,6,7)
InChI key:InChIKey=BBAGRZXUUFLZGT-UHFFFAOYSA-N
SMILES:S(CC)C1=NC(=O)NS1
Synonyms:
  • 1,2,4-Thiadiazol-3(2H)-one, 5-(ethylthio)-
  • 5-(Ethylthio)-1,2,4-thiadiazol-3(2H)-one
Found 0 products.