CAS 56409-57-5
:5-(benzylsulfanyl)-1,2,4-thiadiazol-3(2H)-one
Description:
5-(Benzylsulfanyl)-1,2,4-thiadiazol-3(2H)-one is a heterocyclic compound characterized by the presence of a thiadiazole ring, which contains both sulfur and nitrogen atoms. This compound features a benzylsulfanyl group, indicating the presence of a benzyl moiety attached to a sulfur atom, which contributes to its unique chemical properties. The thiadiazole ring is known for its biological activity, often exhibiting antimicrobial, antifungal, and anti-inflammatory properties. The presence of the benzyl group can enhance lipophilicity, potentially improving the compound's ability to penetrate biological membranes. In terms of solubility, compounds of this nature may exhibit varying degrees of solubility in polar and non-polar solvents, influenced by the functional groups present. The compound's structure suggests potential applications in pharmaceuticals and agrochemicals, where thiadiazole derivatives are often explored for their therapeutic effects. Overall, 5-(benzylsulfanyl)-1,2,4-thiadiazol-3(2H)-one is a compound of interest in medicinal chemistry due to its diverse functional properties and potential biological activities.
Formula:C9H8N2OS2
InChI:InChI=1/C9H8N2OS2/c12-8-10-9(14-11-8)13-6-7-4-2-1-3-5-7/h1-5H,6H2,(H,11,12)
SMILES:c1ccc(cc1)CSc1nc(=O)[nH]s1
Synonyms:- 1,2,4-Thiadiazol-3-ol, 5-[(phenylmethyl)thio]-
- 5-(Benzylsulfanyl)-1,2,4-thiadiazol-3-ol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
5-Benzylthio-3-hydroxy-1,2,4-thiadiazole
CAS:Formula:C9H8N2OS2Color and Shape:SolidMolecular weight:224.3
