CymitQuimica logo

CAS 56410-31-2

:

Ethyl 2-hydroxy-3,6-dimethyl-4-(phenylmethoxy)benzoate

Description:
Ethyl 2-hydroxy-3,6-dimethyl-4-(phenylmethoxy)benzoate, with the CAS number 56410-31-2, is an organic compound that belongs to the class of benzoates. It features a benzoic acid derivative structure, characterized by the presence of an ethyl ester group, a hydroxyl group, and multiple methyl substituents on the aromatic ring. This compound is typically a colorless to pale yellow liquid or solid, depending on its purity and specific conditions. It exhibits moderate solubility in organic solvents and limited solubility in water due to its hydrophobic aromatic structure. Ethyl 2-hydroxy-3,6-dimethyl-4-(phenylmethoxy)benzoate may possess various functional properties, including potential applications in the fields of pharmaceuticals, cosmetics, or as a flavoring agent, owing to its aromatic characteristics. Its stability and reactivity can be influenced by the presence of the hydroxyl and ester functional groups, making it a compound of interest in synthetic organic chemistry and material science.
Formula:C18H20O4
InChI:InChI=1S/C18H20O4/c1-4-21-18(20)16-12(2)10-15(13(3)17(16)19)22-11-14-8-6-5-7-9-14/h5-10,19H,4,11H2,1-3H3
InChI key:InChIKey=RFXRBIVQXSWZLV-UHFFFAOYSA-N
SMILES:O(CC1=CC=CC=C1)C2=C(C)C(O)=C(C(OCC)=O)C(C)=C2
Synonyms:
  • Ethyl 2-hydroxy-3,6-dimethyl-4-(phenylmethoxy)benzoate
  • Benzoic acid, 2-hydroxy-3,6-dimethyl-4-(phenylmethoxy)-, ethyl ester
Found 0 products.