CymitQuimica logo

CAS 56420-30-5

:

N-cyclopentyl-N-nitrosocyclopentanamine

Description:
N-cyclopentyl-N-nitrosocyclopentanamine is a chemical compound characterized by its nitroso group attached to a cyclopentylamine structure. This compound is part of a class of nitrosamines, which are known for their potential carcinogenic properties. It typically appears as a colorless to pale yellow liquid or solid, depending on the specific conditions and purity. The presence of the nitroso group (-N=O) is significant, as it can influence the reactivity and stability of the compound. N-cyclopentyl-N-nitrosocyclopentanamine may undergo various chemical reactions, including decomposition under certain conditions, which can release nitrogen oxides. Due to its structure, it may exhibit moderate solubility in organic solvents but limited solubility in water. Safety precautions are essential when handling this compound, as nitrosamines are often associated with health risks, including potential carcinogenic effects. Proper storage and disposal methods should be followed to mitigate any environmental or health hazards.
Formula:C10H18N2O
InChI:InChI=1/C10H18N2O/c13-11-12(9-5-1-2-6-9)10-7-3-4-8-10/h9-10H,1-8H2
Synonyms:
  • Nitrosodicyclopentylamine
  • Cyclopentanamine, N-cyclopentyl-N-nitroso-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.