
CAS 56430-99-0
:α-Ethyl-α-phenyl-3-(trifluoromethyl)benzenemethanol
Description:
α-Ethyl-α-phenyl-3-(trifluoromethyl)benzenemethanol, with the CAS number 56430-99-0, is an organic compound characterized by its complex structure, which includes a phenyl group, an ethyl substituent, and a trifluoromethyl group attached to a benzenemethanol framework. This compound typically exhibits properties associated with aromatic alcohols, such as moderate solubility in organic solvents and potential reactivity due to the presence of the hydroxyl (-OH) group. The trifluoromethyl group contributes to its unique electronic properties, often enhancing lipophilicity and influencing its reactivity in various chemical reactions. Additionally, the presence of both ethyl and phenyl groups can affect its steric hindrance and overall molecular stability. Such compounds may find applications in pharmaceuticals, agrochemicals, or as intermediates in organic synthesis, owing to their potential biological activity and utility in material science. However, specific safety and handling guidelines should be followed due to the presence of fluorinated groups, which can pose environmental and health concerns.
Formula:C16H15F3O
InChI:InChI=1S/C16H15F3O/c1-2-15(20,12-7-4-3-5-8-12)13-9-6-10-14(11-13)16(17,18)19/h3-11,20H,2H2,1H3
InChI key:InChIKey=DVASNQYQOZHAJN-UHFFFAOYSA-N
SMILES:C(CC)(O)(C1=CC(C(F)(F)F)=CC=C1)C2=CC=CC=C2
Synonyms:- Benzenemethanol, α-ethyl-α-phenyl-3-(trifluoromethyl)-
- RGH 3332
- Zixoryn
- α-Ethyl-α-phenyl-3-(trifluoromethyl)benzenemethanol
- 3-(Trifluoromethyl)-α-ethylbenzhydrol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Flumecinol
CAS:Flumecinol is a hepatic enzyme (cytochrome P-450 monooxygenases) inducer.Formula:C16H15F3OColor and Shape:SolidMolecular weight:280.28
