CAS 56442-19-4

4-[(4-Methylphenyl)methoxy]benzoic acid

Description:

4-[(4-Methylphenyl)methoxy]benzoic acid, with the CAS number 56442-19-4, is an organic compound characterized by its aromatic structure and functional groups. It features a benzoic acid core, which is a carboxylic acid derivative, indicating it has acidic properties. The presence of a methoxy group (-OCH3) and a para-substituted methylphenyl group enhances its hydrophobic characteristics, potentially influencing its solubility in organic solvents. This compound may exhibit biological activity, making it of interest in pharmaceutical and chemical research. Its molecular structure suggests it could participate in various chemical reactions, including esterification and substitution reactions. Additionally, the compound's melting point, boiling point, and other physical properties would be influenced by its molecular weight and the presence of functional groups. Overall, 4-[(4-Methylphenyl)methoxy]benzoic acid is a versatile compound with potential applications in various fields, including materials science and medicinal chemistry.

Formula: C₁₅H₁₄O₃

InChI: InChI=1S/C15H14O3/c1-11-2-4-12(5-3-11)10-18-14-8-6-13(7-9-14)15(16)17/h2-9H,10H2,1H3,(H,16,17)

InChI key: InChIKey=GQDITHZKLNZHHU-UHFFFAOYSA-N

SMILES: O(CC1=CC=C(C)C=C1)C2=CC=C(C(O)=O)C=C2

Synonyms:

• 4-[(4-Methylphenyl)methoxy]benzoic acid
• Benzoic Acid, 4-[(4-Methylphenyl)Methoxy]-
• p-(4-Methylbenzyloxy)benzoic acid
• p-[(p-Methylbenzyl)oxy]benzoic acid

4-[(4-Methylbenzyl)oxy]benzenecarboxylic acid

CAS: 56442-19-4

Formula: C₁₅H₁₄O₃

Purity: 95%

Color and Shape: Solid

Molecular weight: 242.2699

Ref: IN-DA00EDSH

4-[(4-Methylbenzyl)oxy]benzoic acid

CAS: 56442-19-4

4-[(4-Methylbenzyl)oxy]benzoic acid is a high quality chemical that can be used as a building block in the synthesis of complex compounds or as an intermediate in the preparation of speciality chemicals. This reagent is useful for research purposes and can be used to prepare other compounds with similar structures. 4-[(4-Methylbenzyl)oxy]benzoic acid can also be used as a reactant in chemical reactions to produce new products.

Formula: C₁₅H₁₄O₃

Purity: Min. 95%

Color and Shape: White Powder

Molecular weight: 242.27 g/mol

Ref: 3D-FM119097