CAS 56447-11-1
:ethyl 2-cyanocyclopropanecarboxylate
Description:
Ethyl 2-cyanocyclopropanecarboxylate is an organic compound characterized by its unique structure, which includes a cyclopropane ring, a cyano group, and an ester functional group. This compound typically appears as a colorless to pale yellow liquid and is known for its distinctive fruity odor. It is soluble in organic solvents such as ethanol and ether but has limited solubility in water due to its hydrophobic cyclopropane structure. Ethyl 2-cyanocyclopropanecarboxylate is often utilized in organic synthesis, particularly in the preparation of various pharmaceuticals and agrochemicals, owing to its reactivity and ability to undergo various chemical transformations. The presence of the cyano group enhances its electrophilic character, making it a valuable intermediate in synthetic chemistry. Additionally, safety precautions should be observed when handling this compound, as it may pose health risks if ingested or inhaled. Overall, ethyl 2-cyanocyclopropanecarboxylate is a versatile compound with significant applications in chemical synthesis.
Formula:C7H9NO2
InChI:InChI=1/C7H9NO2/c1-2-10-7(9)6-3-5(6)4-8/h5-6H,2-3H2,1H3
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
Ethyl 2-cyanocyclopropane-1-carboxylate
CAS:Formula:C7H9NO2Purity:95%Color and Shape:LiquidMolecular weight:139.1519Ethyl 2-cyanocyclopropane-1-carboxylate
CAS:Ethyl 2-cyanocyclopropane-1-carboxylatePurity:96%,Mixture of cis and trans isomersMolecular weight:139.15g/molEthyl 2-cyanocyclopropanecarboxylate
CAS:Formula:C7H9NO2Purity:95%Color and Shape:LiquidMolecular weight:139.154ethyl 2-cyanocyclopropane-1-carboxylate
CAS:Ethyl 2-cyanocyclopropane-1-carboxylate is a reactive chemical reagent that can be used to synthesize a variety of compounds. It is an aliphatic compound with a carbonyl group at the end of the molecule and belongs to a class of compounds called chlorohydrins. Ethyl 2-cyanocyclopropane-1-carboxylate has been used as an organoindium compound for the synthesis of stilbene derivatives. It can also be used to synthesize chlorinated alkenes, oxiranes, and other cyclopropanes. Ethyl 2-cyanocyclopropane-1-carboxylate can react with alcohols or phenols in presence of acid to form acetals or ketals, respectively.
Formula:C7H9NO2Purity:Min. 95%Molecular weight:139.15 g/mol



