
CAS 56448-20-5
:Butanedioic acid, 1-[(3E,6S,16R)-16-methyl-2,5-dioxooxacyclohexadec-3-en-6-yl] ester
Description:
Butanedioic acid, 1-[(3E,6S,16R)-16-methyl-2,5-dioxooxacyclohexadec-3-en-6-yl] ester, also known by its CAS number 56448-20-5, is an organic compound characterized by its ester functional group derived from butanedioic acid (also known as succinic acid) and a complex cyclic structure. This compound features a bicyclic framework that includes multiple functional groups, contributing to its potential reactivity and biological activity. The presence of the dioxo and ester functionalities suggests it may participate in various chemical reactions, such as esterification or hydrolysis. Its stereochemistry, indicated by the specific configuration at multiple chiral centers, may influence its physical properties, such as solubility and melting point, as well as its biological interactions. Compounds of this nature are often studied for their potential applications in pharmaceuticals, agrochemicals, or as intermediates in organic synthesis. However, specific data regarding its toxicity, stability, and environmental impact would require further investigation and analysis.
Formula:C20H30O7
InChI:InChI=1S/C20H30O7/c1-15-9-7-5-3-2-4-6-8-10-17(16(21)11-13-19(24)26-15)27-20(25)14-12-18(22)23/h11,13,15,17H,2-10,12,14H2,1H3,(H,22,23)/b13-11+/t15-,17+/m1/s1
InChI key:InChIKey=CAOCHWFVLJETKN-SADTYBKJSA-N
SMILES:O(C(CCC(O)=O)=O)[C@@H]1C(=O)/C=C/C(=O)O[C@H](C)CCCCCCCCC1
Synonyms:- Butanedioic acid, mono(16-methyl-2,5-dioxooxacyclohexadec-3-en-6-yl) ester, [6S-(3E,6R*,16S*)]-
- Mono(16-methyl-2,5-dioxooxacyclohexadec-3-en-6-yl) succinate
- Oxacyclohexadecane, butanedioic acid deriv.
- Butanedioic acid, mono[(3E,6S,16R)-16-methyl-2,5-dioxooxacyclohexadec-3-en-6-yl] ester
- Butanedioic acid, 1-[(3E,6S,16R)-16-methyl-2,5-dioxooxacyclohexadec-3-en-6-yl] ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
A 26771B
CAS:A 26771B is an antibiotic in the class of macrolide lactone.Formula:C20H30O7Color and Shape:SolidMolecular weight:382.45
