CAS 564483-19-8
:phosphine, bis(1,1-dimethylethyl)[2',4',6'-tris(1-methylethyl)[1,1'-biphenyl]-2-yl]-
Description:
Phosphine, bis(1,1-dimethylethyl)[2',4',6'-tris(1-methylethyl)[1,1'-biphenyl]-2-yl]- is a phosphine compound characterized by its complex structure, which includes multiple alkyl groups and a biphenyl moiety. This compound typically exhibits properties associated with phosphines, such as being a potential ligand in coordination chemistry. The presence of bulky tert-butyl groups enhances its steric hindrance, which can influence its reactivity and stability. Phosphines are known for their ability to act as nucleophiles and can participate in various chemical reactions, including those in catalysis and organic synthesis. The specific arrangement of substituents in this compound may also impart unique electronic properties, making it suitable for specialized applications in materials science or organic chemistry. As with many phosphine derivatives, safety precautions should be taken when handling this substance, as phosphines can be toxic and may pose environmental hazards. Overall, this compound represents a specialized class of phosphines with potential utility in advanced chemical applications.
Formula:C29H45P
InChI:InChI=1/C29H45P/c1-19(2)22-17-24(20(3)4)27(25(18-22)21(5)6)23-15-13-14-16-26(23)30(28(7,8)9)29(10,11)12/h13-21H,1-12H3
SMILES:CC(C)c1cc(C(C)C)c(c2ccccc2P(C(C)(C)C)C(C)(C)C)c(c1)C(C)C
Synonyms:- 2-Di-t-butylphosphino-2',4',6'-tri-i-propyl-1,1'-biphenyl
- 2-Di-tert-butylphosphino-2',4',6'-triisopropylbiphenyl
- tert-Butyl X-Phos
- Di-Tert-Butyl[2',4',6'-Tri(Propan-2-Yl)Biphenyl-2-Yl]Phosphane
- t-butylXPhos
- tBuXPhos
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
2-Di-t-butylphosphino-2',4',6'-tri-i-propyl-1,1'-biphenyl, min. 98% t-BuXPhos
CAS:<p>2-Di-t-butylphosphino-2',4',6'-tri-i-propyl-1,1'-biphenyl, min. 98% t-BuXPhos</p>Formula:C29H45PPurity:min. 98%Color and Shape:white xtl.Molecular weight:424.64Di-tert-butyl(2',4',6'-triisopropyl-[1,1'-biphenyl]-2-yl)phosphine
CAS:Formula:C29H45PPurity:96%Color and Shape:SolidMolecular weight:424.6414Di-tert-butyl(2',4',6'-triisopropyl-[1,1'-biphenyl]-2-yl)phosphine
CAS:Di-tert-butyl(2',4',6'-triisopropyl-[1,1'-biphenyl]-2-yl)phosphineFormula:C29H45PPurity:≥95%Color and Shape: white crystalline powderMolecular weight:424.64g/molDI-TERT-BUTYL(2′,4′,6′-TRIISOPROPYL-[1,1′-BIPHENYL]-2-YL)PHOSPHINE
CAS:Purity:96%Molecular weight:424.65301512-Di-tert-butylphosphino-2',4',6'-triisopropylbiphenyl
CAS:Formula:C29H45PPurity:>98.0%(T)(qNMR)Color and Shape:White to Almost white powder to crystalMolecular weight:424.652-Di-tert-butylphosphino-2',4',6'-triisopropylbiphenyl
CAS:<p>2-Di-tert-butylphosphino-2',4',6'-triisopropylbiphenyl is a chemical compound that has been used as an antirheumatic, antiviral, and anticancer drug. It is a nucleophile that can be used to undergo nucleophilic substitutions with halides and other activated substrates. This compound has been shown to inhibit the replication of viruses such as herpes simplex virus type 1 (HSV-1) and hepatitis B virus (HBV). 2-Di-tert-butylphosphino-2',4',6'-triisopropylbiphenyl can also be used to treat eye disorders such as cytostatic effects and ocular hypertension by inhibiting the growth of cells in the retina.</p>Formula:C29H45PPurity:Min. 95%Color and Shape:White To Off-White SolidMolecular weight:424.64 g/mol





