CAS 56452-52-9
:alpha-methyl-D-tryptophan
Description:
Alpha-methyl-D-tryptophan is an amino acid derivative and a structural analog of the natural amino acid tryptophan. It is characterized by the presence of a methyl group at the alpha position relative to the amino group, which influences its biochemical properties and interactions. This compound is known for its role in research, particularly in studies related to protein synthesis and neurotransmitter function. Alpha-methyl-D-tryptophan can act as an inhibitor of certain enzymes, such as tryptophan hydroxylase, which is involved in serotonin biosynthesis. Its unique structure allows it to participate in various biochemical pathways, making it a valuable tool in pharmacological studies. Additionally, it is often used in the synthesis of peptides and proteins in laboratory settings. The compound is typically handled with standard laboratory safety precautions, as with other amino acids and biochemical reagents. Its applications extend to fields such as neurobiology and pharmacology, where it aids in understanding the role of tryptophan in physiological processes.
Formula:C12H14N2O2
InChI:InChI=1/C12H14N2O2/c1-12(13,11(15)16)6-8-7-14-10-5-3-2-4-9(8)10/h2-5,7,14H,6,13H2,1H3,(H,15,16)/t12-/m1/s1
SMILES:C[C@@](Cc1c[nH]c2ccccc12)(C(=O)O)N
Synonyms:- D-tryptophan, a-methyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 3 products.
α-Methyl-D-tryptophan
CAS:Controlled ProductFormula:C12H14N2O2Color and Shape:NeatMolecular weight:218.25α-Methyl-D-tryptophan Sodium Salt
CAS:Controlled ProductStability Hygroscopic
Applications α-Methyl-D-tryptophan Sodium Salt is a therapeutic and carrier molecule.
References Seldon, H., et al.: Brain Res., 249, 211 (1982); Leboyer, M., et al.: Biol. Psychiatry, 45, 58 (1999); Galuske, R., et al.: Science, 289, 1946 (2000); Courchesne, E., et al.: Neurology, 57, 245 (2001)Formula:C12H13N2NaO2Color and Shape:NeatMolecular weight:240.23
