CAS 56456-47-4: 2,4-Difluorobenzenemethanol
Description:2,4-Difluorobenzenemethanol, with the CAS number 56456-47-4, is an organic compound characterized by a benzene ring substituted with two fluorine atoms at the 2 and 4 positions and a hydroxymethyl group (-CH2OH) attached to the benzene. This compound typically appears as a colorless to pale yellow liquid or solid, depending on its state at room temperature. It is polar due to the presence of the hydroxymethyl group, which can engage in hydrogen bonding, influencing its solubility in polar solvents like water. The fluorine substituents contribute to the compound's unique electronic properties, potentially enhancing its reactivity and stability compared to non-fluorinated analogs. 2,4-Difluorobenzenemethanol may be utilized in various applications, including pharmaceuticals, agrochemicals, and as an intermediate in organic synthesis. Its physical and chemical properties, such as boiling point, melting point, and reactivity, can vary based on the specific conditions and purity of the sample. Safety data should be consulted for handling and storage, as with any chemical substance.
Formula:C7H6F2O
InChI:InChI=1S/C7H6F2O/c8-6-2-1-5(4-10)7(9)3-6/h1-3,10H,4H2
InChI key:InChIKey=NIJZBWHOHNWJBX-UHFFFAOYSA-N
SMILES:FC1=CC=C(C(F)=C1)CO
- Synonyms:
- (2,4-Difluorophenyl)Methanol
- 2,4-Difluorobenzenemethanol
- 2,4-Difluorobenzyl alcohol
- Benzenemethanol, 2,4-difluoro-
