CAS 56464-51-8

{[(1E)-1-methyl-3-oxo-3-phenylpropylidene]amino}acetonitrile

Description:

The chemical substance known as {(1E)-1-methyl-3-oxo-3-phenylpropylidene]amino}acetonitrile, with the CAS number 56464-51-8, is characterized by its unique structural features and functional groups. It contains a ketone group, an imine linkage, and a nitrile group, which contribute to its reactivity and potential applications in organic synthesis. The presence of the phenyl group indicates aromatic characteristics, which can influence its electronic properties and stability. This compound may exhibit polar characteristics due to the presence of the nitrile and ketone functionalities, affecting its solubility in various solvents. Additionally, the configuration of the double bond (E-isomer) suggests specific stereochemical properties that could impact its biological activity or interaction with other molecules. Overall, this compound's diverse functional groups make it a candidate for various chemical reactions, including nucleophilic additions and condensation reactions, potentially leading to the synthesis of more complex organic molecules.

Formula: C₁₂H₁₂N₂O

InChI: InChI=1/C12H12N2O/c1-10(14-8-7-13)9-12(15)11-5-3-2-4-6-11/h2-6H,8-9H2,1H3/b14-10+

2-((4-Oxo-4-phenylbut-2-en-2-yl)amino)acetonitrile

CAS: 56464-51-8

Formula: C₁₂H₁₂N₂O

Color and Shape: Solid

Molecular weight: 200.2365

Ref: IN-DA00EE0V

2-{[(2E)-4-Oxo-4-phenylbut-2-en-2-yl]amino}acetonitrile

CAS: 56464-51-8

2-{[(2E)-4-Oxo-4-phenylbut-2-en-2-yl]amino}acetonitrile

Purity: 95%

Molecular weight: 200.24g/mol

Ref: 54-OR32964