CAS 56469-10-4: 5-(1,1-Dimethylheptyl)resorcinol
Description:5-(1,1-Dimethylheptyl)resorcinol, identified by its CAS number 56469-10-4, is an organic compound that belongs to the class of resorcinols, which are characterized by their dihydroxybenzene structure. This particular compound features a branched alkyl chain, specifically a 1,1-dimethylheptyl group, which contributes to its hydrophobic properties. The presence of hydroxyl groups (-OH) in its structure imparts potential for hydrogen bonding, influencing its solubility and reactivity. Typically, compounds like this may exhibit antioxidant properties and can be utilized in various applications, including cosmetics and pharmaceuticals, due to their ability to stabilize formulations and protect against oxidative stress. Additionally, the unique structure may affect its biological activity, making it of interest in research related to medicinal chemistry. However, specific safety and handling guidelines should be followed, as with any chemical substance, to mitigate potential risks associated with its use.
Formula:C15H24O2
InChI:InChI=1S/C15H24O2/c1-4-5-6-7-8-15(2,3)12-9-13(16)11-14(17)10-12/h9-11,16-17H,4-8H2,1-3H3
InChI key:InChIKey=GWBGUJWRDDDVBI-UHFFFAOYSA-N
SMILES:OC=1C=C(O)C=C(C1)C(C)(C)CCCCCC
- Synonyms:
- 1,3-Benzenediol, 5-(1,1-dimethylheptyl)-
- 5-(1,1-Dimethyl-Heptyl)Benzene-1,3-Diol
- 5-(1,1-Dimethyl-Heptyl)Resorcinol
- 5-(1,1-Dimethylheptyl)-1,3-benzenediol
- 5-(1,1-Dimethylheptyl)benzene-1,3-diol
- 5-(2-Methyloctan-2-Yl)Benzene-1,3-Diol
- 5-(1,1-Dimethylheptyl)resorcinol
