CAS 56472-29-8
:9-Octadecenoic acid, 2-hydroxy-, (9Z)-
Description:
9-Octadecenoic acid, 2-hydroxy-, (9Z)-, commonly known as ricinoleic acid, is a monounsaturated fatty acid characterized by its long carbon chain and a hydroxyl group at the second carbon position. It features a cis double bond between the ninth and tenth carbon atoms, which contributes to its unique properties. This fatty acid is typically found in castor oil, where it constitutes a significant portion of the fatty acid profile. Ricinoleic acid is known for its hydrophilic nature due to the hydroxyl group, which enhances its solubility in water compared to other fatty acids. It exhibits various functional properties, including emulsifying, surfactant, and lubricant characteristics, making it valuable in cosmetic, pharmaceutical, and industrial applications. Additionally, ricinoleic acid has been studied for its potential anti-inflammatory and analgesic effects. Its molecular structure and properties make it an important compound in both natural and synthetic chemistry contexts.
Formula:C18H34O3
InChI:InChI=1S/C18H34O3/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17(19)18(20)21/h9-10,17,19H,2-8,11-16H2,1H3,(H,20,21)/b10-9-
InChI key:JBSOOFITVPOOSY-KTKRTIGZSA-N
SMILES:CCCCCCCC/C=C\CCCCCCC(C(=O)O)O
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 8 products.
(9Z)-2-Hydroxy-9-octadecenoic acid
CAS:Formula:C18H34O3Purity:98%Color and Shape:SolidMolecular weight:298.4608(Rac)-Idroxioleic acid
CAS:(Rac)-Idroxioleic acidFormula:C18H34O3Purity:≥98%Color and Shape:SolidMolecular weight:298.462-Hydroxy Oleic Acid (Mixture of Z and E Isomers)
CAS:Formula:C18H34O3Color and Shape:White To Off-White SolidMolecular weight:298.472-Hydroxy Oleic Acid-d17 (Mixture of Z and E Isomers)
CAS:Formula:C18H17O3D17Color and Shape:Brown Sticky LiquidMolecular weight:315.572-Hydroxy-9(Z)-octadecenoic acid
CAS:Formula:C18H34O3Purity:>98%Color and Shape:In solution, EthanolMolecular weight:298.46(Rac)-Idroxioleic acid
CAS:(Rac)-Idroxioleic acid (2-Hydroxyoleic acid) is a fatty acid amide hydrolase inhibitor with anti-tumor effect.Formula:C18H34O3Purity:99.74% - ≥98%Color and Shape:White SolidMolecular weight:298.46(Rac)-Idroxioleic acid
CAS:(Z)-2-Hydroxyoctadec-9-enoic acidFormula:C18H34O3Purity:98%Molecular weight:298.462-Hydroxy Oleic Acid
CAS:Controlled ProductApplications An oleic acid synthetic analog that is an effective non-toxic anticancer drug with a wide spectrum against different types of cancer. An antihypertensive.
References Llado, V. et al.: J. Cell. Molec. Med., 14, 659 (2010); Alemany, R. et al.: J. Lip. Res., 47, 1762 (2006); Martinez, J. et al.: J. Pharmacol. Exp. Therap., 315, 466 (2005);Formula:C18H34O3Color and Shape:NeatMolecular weight:298.46






