CAS 56473-92-8

Thieno[3,2-b]pyridine-5-carboxylic acid

Description:

Thieno[3,2-b]pyridine-5-carboxylic acid is a heterocyclic organic compound characterized by its fused thieno and pyridine rings, which contribute to its unique chemical properties. This compound features a carboxylic acid functional group at the 5-position of the pyridine ring, enhancing its reactivity and solubility in polar solvents. The presence of the thieno ring introduces additional electron density and can influence the compound's biological activity, making it of interest in medicinal chemistry. Thieno[3,2-b]pyridine derivatives are often studied for their potential applications in pharmaceuticals, particularly as anti-inflammatory, antimicrobial, or anticancer agents. The compound's structure allows for various substitution patterns, which can further modify its chemical behavior and biological interactions. Additionally, its molecular properties, such as melting point, boiling point, and solubility, can vary based on the specific conditions and the presence of substituents. Overall, Thieno[3,2-b]pyridine-5-carboxylic acid is a versatile compound with significant implications in chemical research and drug development.

Formula: C₈H₅NO₂S

InChI: InChI=1S/C8H5NO2S/c10-8(11)6-1-2-7-5(9-6)3-4-12-7/h1-4H,(H,10,11)

InChI key: InChIKey=CWBYTSQAVGCXFW-UHFFFAOYSA-N

SMILES: C(O)(=O)C=1N=C2C(=CC1)SC=C2

Synonyms:

• Thieno[3,2-b]pyridine-5-carboxylic acid

THIENO[3,2-B]PYRIDINE-5-CARBOXYLIC ACID

CAS: 56473-92-8

Formula: C₈H₅NO₂S

Purity: 95.0%

Molecular weight: 179.19

Ref: 10-F468776

Thieno[3,2-b]pyridine-5-carboxylic Acid

Controlled Product

CAS: 56473-92-8

Formula: C₈H₅NO₂S

Color and Shape: Neat

Molecular weight: 179.196

Ref: TR-T344460

Thieno[3,2-b]pyridine-5-carboxylic acid

CAS: 56473-92-8

Versatile small molecule scaffold

Formula: C₈H₅NO₂S

Purity: Min. 95%

Molecular weight: 179.2 g/mol

Ref: 3D-GCA47392