CAS 56475-13-9
:2-chlorocyclohex-1-ene-1-carboxylic acid
Description:
2-Chlorocyclohex-1-ene-1-carboxylic acid is an organic compound characterized by its cyclohexene structure, which includes a chlorine substituent and a carboxylic acid functional group. This compound features a double bond in the cyclohexene ring, contributing to its reactivity and potential for undergoing various chemical reactions, such as electrophilic addition. The presence of the carboxylic acid group (-COOH) imparts acidic properties, allowing it to participate in acid-base reactions and potentially form salts or esters. The chlorine atom introduces additional polarity and can influence the compound's solubility and reactivity. Typically, compounds like this may exhibit moderate to high reactivity due to the combination of the double bond and the carboxylic acid functionality. In terms of physical properties, it may be a liquid or solid at room temperature, depending on its molecular weight and structure. Safety considerations should be taken into account, as halogenated compounds can pose health risks, and proper handling and storage protocols should be followed.
Formula:C7H9ClO2
InChI:InChI=1/C7H9ClO2/c8-6-4-2-1-3-5(6)7(9)10/h1-4H2,(H,9,10)
SMILES:C1CCC(=C(C1)C(=O)O)Cl
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 1 products.
2-Chlorocyclohex-1-ene-1-carboxylic acid
CAS:<p>2-Chlorocyclohex-1-ene-1-carboxylic acid is a synthetic compound that has been used as a reactant for the production of phthalic anhydride. The reaction mechanism begins with the formation of isocyanide, which reacts with benzoic acid to form an intermediate benzoyl isocyanide. This intermediate reacts with the acetic acid to produce 2-chlorocyclohexanecarboxylic acid, which in turn undergoes hydrolysis to give phthalic anhydride.</p>Formula:C7H9ClO2Purity:Min. 95%Molecular weight:160.6 g/mol
