CAS 56480-48-9
:1H-Indolamine
Description:
1H-Indolamine, with the CAS number 56480-48-9, is an organic compound characterized by its indole structure, which consists of a fused benzene and pyrrole ring. This compound features an amino group (-NH2) attached to the indole ring, making it a member of the indoleamine family. It is typically a colorless to pale yellow solid or liquid, depending on its purity and form. 1H-Indolamine is known for its role in biological systems, particularly as a precursor to various neurotransmitters, including serotonin. Its chemical properties include moderate solubility in water and organic solvents, and it can participate in various chemical reactions, such as electrophilic substitutions due to the electron-rich nature of the indole ring. Additionally, 1H-Indolamine exhibits potential pharmacological activities, making it of interest in medicinal chemistry and research related to neurobiology and psychiatry. Safety data should be consulted for handling and usage, as with any chemical substance.
Formula:C8H8N2
InChI:InChI=1/C8H8N2/c9-8-5-6-3-1-2-4-7(6)10-8/h1-5,10H,9H2
SMILES:c1ccc2c(c1)cc(N)[nH]2
Synonyms:- Indolamine
- 1H-Indolamine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
