CAS 56488-00-7
:Piperidine, 1-[2-cyano-1-(cyanoimino)ethyl]-
Description:
Piperidine, 1-[2-cyano-1-(cyanoimino)ethyl]- is a chemical compound characterized by its piperidine ring structure, which is a six-membered saturated nitrogen-containing heterocycle. The compound features a cyano group and a cyanoimino group attached to the ethyl chain, contributing to its reactivity and potential applications in organic synthesis. It is typically a colorless to pale yellow liquid or solid, depending on its purity and specific conditions. The presence of multiple cyano groups suggests that it may exhibit significant polarity and potential for hydrogen bonding, influencing its solubility in various solvents. This compound may be of interest in medicinal chemistry and materials science due to its unique functional groups, which can participate in various chemical reactions, including nucleophilic additions and cycloadditions. Safety data should be consulted, as compounds containing cyano groups can be toxic and require careful handling. Overall, its structural features make it a valuable compound for further research and development in chemical applications.
Formula:C9H12N4
InChI:InChI=1S/C9H12N4/c10-5-4-9(12-8-11)13-6-2-1-3-7-13/h1-4,6-7H2
InChI key:InChIKey=CXAPGRNCBJXCEF-UHFFFAOYSA-N
SMILES:C(CC#N)(=NC#N)N1CCCCC1
Synonyms:- 3-Cyanoimino-3-piperidin-1-yl-propionitrile
- Piperidine, 1-[2-cyano-1-(cyanoimino)ethyl]-
- [(1E)-2-cyano-1-(piperidin-1-yl)ethylidene]cyanamide
- 1-(2-Cyano-1-(cyanoimino)ethyl)piperidine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 3 products.
Minoxidil Impurity 9
CAS:Formula:C9H12N4Color and Shape:White To Off-White SolidMolecular weight:176.22[2-Cyano-1-(piperidin-1-yl)ethylidene]cyanamide
CAS:Formula:C9H12N4Color and Shape:NeatMolecular weight:176.22


