CAS 56492-83-2: 5-Butylthio-1,3,4-thiadiazole-2-thiol

Description: 5-Butylthio-1,3,4-thiadiazole-2-thiol is a heterocyclic compound featuring a thiadiazole ring, which is characterized by the presence of sulfur and nitrogen atoms. This compound typically exhibits properties associated with thiols, such as a strong sulfur odor and potential reactivity due to the presence of the thiol (-SH) functional group. The butylthio substituent enhances its lipophilicity, potentially influencing its solubility in organic solvents. Thiadiazoles are known for their biological activity, and compounds like 5-butylthio-1,3,4-thiadiazole-2-thiol may exhibit antimicrobial, antifungal, or herbicidal properties, making them of interest in agricultural and pharmaceutical applications. The presence of sulfur in the structure can also contribute to unique electronic properties, which may be exploited in various chemical reactions. Safety data should be consulted for handling, as thiol compounds can be toxic and irritating. Overall, this compound represents a class of sulfur-containing heterocycles with diverse applications in chemistry and biology.

Formula: C₆H₁₀N₂S₃

InChI: InChI=1/C6H10N2S3/c1-2-3-4-10-6-8-7-5(9)11-6/h2-4H2,1H3,(H,7,9)

Synonyms:

• 5-(butylsulfanyl)-1,3,4-thiadiazole-2(3H)-thione

5-Butylthio-1,3,4-thiadiazole-2-thiol

CAS: 56492-83-2

• Molecular weight: 206.00061132

5-(Butylsulfanyl)-1,3,4-thiadiazole-2-thiol

CAS: 56492-83-2

Versatile small molecule scaffold

• Formula: C₆H₁₀N₂S₃
• Purity: Min. 95%
• Molecular weight: 206.4 g/mol