![2-[10(Z)-Heptadecenyl]-6-methoxy-1,4-benzoquinone](/_next/image/?url=https%3A%2Fstatic.cymitquimica.com%2Fcas-image%2Fthumb-webp%2F345975-2-10-z-heptadecenyl-6-methoxy-14-benzoquinone.webp&w=3840&q=75)
CAS 56495-82-0
:2-[10(Z)-Heptadecenyl]-6-methoxy-1,4-benzoquinone
Description:
2-[10(Z)-Heptadecenyl]-6-methoxy-1,4-benzoquinone, with the CAS number 56495-82-0, is a chemical compound characterized by its unique structure, which includes a benzoquinone moiety and a long-chain unsaturated fatty acid derivative. This compound features a methoxy group at the 6-position of the benzoquinone ring and a heptadecenyl chain at the 2-position, contributing to its hydrophobic properties. The presence of the double bond in the heptadecenyl chain introduces cis/trans isomerism, which can influence its biological activity and reactivity. Benzoquinones are known for their redox properties, allowing them to participate in various biochemical processes, including electron transfer and as potential antioxidants. The compound may exhibit antimicrobial or anti-inflammatory activities, making it of interest in pharmaceutical and biochemical research. Its solubility characteristics are likely influenced by both the hydrophobic fatty chain and the polar benzoquinone structure, affecting its interactions in biological systems. Overall, this compound represents a fascinating intersection of organic chemistry and potential biological applications.
Formula:C24H38O3
InChI:InChI=1/C24H38O3/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-21-19-22(25)20-23(27-2)24(21)26/h8-9,19-20H,3-7,10-18H2,1-2H3/b9-8-
InChI key:InChIKey=YYCCUFKHCNSRIA-HJWRWDBZSA-N
SMILES:CCCCCC/C=C\CCCCCCCCCC1=CC(=O)C=C(C1=O)OC
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 3 products.
