CymitQuimica logo

CAS 56496-16-3

:

6-Azoniaspiro[5.5]undecane, chloride

Description:
6-Azoniaspiro[5.5]undecane, chloride, with the CAS number 56496-16-3, is a quaternary ammonium compound characterized by its unique spirocyclic structure. This compound features a nitrogen atom that carries a positive charge, contributing to its classification as an azonium salt. The spiro structure indicates that it contains two fused rings, which can influence its steric and electronic properties. Typically, quaternary ammonium compounds exhibit good solubility in polar solvents and can act as surfactants or phase transfer catalysts. The chloride ion serves as the counterion, which can affect the compound's stability and reactivity. In terms of applications, such compounds are often explored in fields such as organic synthesis, materials science, and medicinal chemistry due to their ability to interact with biological membranes and their potential antimicrobial properties. However, specific safety and handling guidelines should be followed, as with any chemical substance, to mitigate risks associated with its use.
Formula:C10H20N・Cl
InChI:InChI=1S/C10H20N.ClH/c1-3-7-11(8-4-1)9-5-2-6-10-11;/h1-10H2;1H/q+1;/p-1
InChI key:ANJFPNVWAISDQR-UHFFFAOYSA-M
SMILES:C1CC[N+]2(CC1)CCCCC2.[Cl-]
Found 2 products.