CAS 56516-71-3

[[carboxymethyl(nitroso)amino]methyl-hydroxy-phosphoryl]oxysodium

Description:

The chemical substance known as [[carboxymethyl(nitroso)amino]methyl-hydroxy-phosphoryl]oxysodium, with the CAS number 56516-71-3, is a complex organic compound that features a combination of functional groups, including carboxymethyl, nitroso, amino, hydroxy, and phosphoryl moieties. This structure suggests that the compound may exhibit both hydrophilic and hydrophobic characteristics, potentially influencing its solubility and reactivity in various environments. The presence of the nitroso group indicates that it may have unique redox properties, which could be relevant in biological or chemical applications. Additionally, the phosphoryl group suggests potential interactions with biological systems, particularly in relation to energy transfer or signaling pathways. The sodium component implies that the compound is likely to be soluble in water, making it suitable for various applications in pharmaceuticals or biochemistry. Overall, the diverse functional groups present in this compound may contribute to its reactivity and potential utility in various chemical and biological contexts.

Formula: C₃H₆N₂NaO₆P

InChI: InChI=1/C3H7N2O6P.Na/c6-3(7)1-5(4-8)2-12(9,10)11;/h1-2H2,(H,6,7)(H2,9,10,11);/q;+1/p-1/rC3H6N2NaO6P/c6-12-13(10,11)2-5(4-9)1-3(7)8/h1-2H2,(H,7,8)(H,10,11)

SMILES: C(C(=O)O)N(CP(=O)(O)O)N=O.[Na]

N-Nitrosoglyphosate sodium

CAS: 56516-71-3

N-Nitrosoglyphosate sodium, a nitrosamine degradation product and synthetic impurity of glyphosate herbicide [1], is a chemical compound resulting from the

Formula: C₃H₆N₂NaO₆P

Color and Shape: Solid

Molecular weight: 220.05

Ref: TM-T74078

Glyphosate-N-nitroso sodium

Controlled Product

CAS: 56516-71-3

Formula: C₃H₆N₂O₆P·Na

Color and Shape: Neat

Molecular weight: 220.05

Ref: 04-C14055400