CymitQuimica logo

CAS 56516-72-4

:

[nitroso(phosphonomethyl)amino]acetic acid

Description:
[Nitroso(phosphonomethyl)amino]acetic acid, with the CAS number 56516-72-4, is a chemical compound that features a unique combination of functional groups, including a nitroso group, a phosphonomethyl group, and a carboxylic acid. This compound is characterized by its potential use in various applications, particularly in the fields of agriculture and pharmaceuticals. The presence of the phosphonomethyl group suggests that it may exhibit properties related to phosphonate chemistry, which can be significant in herbicidal activity or as a biochemical agent. The nitroso group can impart unique reactivity, potentially allowing for interactions with biological systems or other chemical species. Additionally, the carboxylic acid functionality contributes to its solubility in polar solvents and may influence its biological activity. Overall, the compound's structure suggests a complex interplay of reactivity and functionality, making it of interest for further research and application in various scientific domains.
Formula:C3H7N2O6P
InChI:InChI=1/C3H7N2O6P/c6-3(7)1-5(4-8)2-12(9,10)11/h1-2H2,(H,6,7)(H2,9,10,11)
SMILES:C(C(=O)O)N(CP(=O)(O)O)N=O
Synonyms:
  • Acetic Acid, 2-[Nitroso(Phosphonomethyl)Amino]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 3 products.