CAS 565165-72-2

2-Chloro-N-[4-(3,4-difluorophenyl)-2-thiazolyl]propanamide

Description:

2-Chloro-N-[4-(3,4-difluorophenyl)-2-thiazolyl]propanamide, with the CAS number 565165-72-2, is a synthetic organic compound characterized by its unique structural features. It contains a thiazole ring, which is a five-membered heterocyclic compound containing sulfur and nitrogen, contributing to its biological activity. The presence of a chloro group and a difluorophenyl moiety enhances its lipophilicity and may influence its interaction with biological targets. This compound is typically studied for its potential pharmacological properties, particularly in the context of medicinal chemistry, where modifications to the thiazole and amide functionalities can affect its efficacy and selectivity. Its molecular structure suggests potential applications in drug development, particularly in areas targeting specific receptors or enzymes. As with many compounds in this category, understanding its solubility, stability, and reactivity is crucial for evaluating its practical applications in pharmaceuticals or agrochemicals. Safety and handling precautions are essential due to the presence of halogenated groups, which may pose environmental and health risks.

Formula: C₁₂H₉ClF₂N₂OS

InChI: InChI=1S/C12H9ClF2N2OS/c1-6(13)11(18)17-12-16-10(5-19-12)7-2-3-8(14)9(15)4-7/h2-6H,1H3,(H,16,17,18)

InChI key: InChIKey=BLOXIDYZMHFRLV-UHFFFAOYSA-N

SMILES: N(C(C(C)Cl)=O)C1=NC(=CS1)C2=CC(F)=C(F)C=C2

Synonyms:

• 2-Chloro-N-[4-(3,4-difluorophenyl)-2-thiazolyl]propanamide
• Propanamide, 2-chloro-N-[4-(3,4-difluorophenyl)-2-thiazolyl]-

2-Chloro-N-[4-(3,4-difluorophenyl)-1,3-thiazol-2-yl]propanamide

CAS: 565165-72-2

2-Chloro-N-[4-(3,4-difluorophenyl)-1,3-thiazol-2-yl]propanamide

Purity: 95%

Molecular weight: 302.73g/mol

Ref: 54-PC101872

2-Chloro-N-[4-(3,4-difluorophenyl)-1,3-thiazol-2-yl]propanamide

CAS: 565165-72-2

Purity: 97%

Molecular weight: 302.7200012

Ref: 10-F641799