CAS 56518-42-4
:4-Bromo-3,5-dimethoxybenzoic acid
Description:
4-Bromo-3,5-dimethoxybenzoic acid is an aromatic carboxylic acid characterized by the presence of a bromine atom and two methoxy groups on a benzene ring. Its molecular structure features a benzoic acid core, which contributes to its acidic properties. The bromine substituent typically enhances the compound's reactivity and can influence its biological activity, while the methoxy groups can affect solubility and polarity. This compound is often used in organic synthesis and may serve as an intermediate in the production of pharmaceuticals or agrochemicals. Its melting point, solubility in various solvents, and stability under different conditions are important characteristics for practical applications. Additionally, the presence of functional groups like the carboxylic acid and methoxy groups can facilitate various chemical reactions, including esterification and nucleophilic substitutions. Overall, 4-Bromo-3,5-dimethoxybenzoic acid is a versatile compound with significant implications in chemical research and industrial applications.
Formula:C9H9BrO4
InChI:InChI=1S/C9H9BrO4/c1-13-6-3-5(9(11)12)4-7(14-2)8(6)10/h3-4H,1-2H3,(H,11,12)
InChI key:InChIKey=JNFZULSIYYVRJO-UHFFFAOYSA-N
SMILES:O(C)C1=C(Br)C(OC)=CC(C(O)=O)=C1
Synonyms:- 3,5-Dimethoxy-4-bromobenzoic acid
- 4-Bromo-3,5-Dimethoxybenzoate
- Benzoic acid, 4-bromo-3,5-dimethoxy-
- 4-Bromo-3,5-dimethoxybenzoic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 8 products.
4-Bromo-3,5-dimethoxybenzoic Acid
CAS:Formula:C9H9BrO4Purity:>97.0%(T)(HPLC)Color and Shape:White to Light yellow powder to crystalMolecular weight:261.074-Bromo-3,5-dimethoxybenzoic acid, 98%
CAS:This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo SciFormula:C9H9BrO4Purity:98%Color and Shape:White to pale cream, Crystalline powderMolecular weight:261.074-Bromo-3,5-dimethoxybenzoic acid
CAS:Formula:C9H9BrO4Purity:97%Color and Shape:SolidMolecular weight:261.06944-Bromo-3,5-dimethoxybenzoic acid
CAS:4-Bromo-3,5-dimethoxybenzoic acidPurity:98%Molecular weight:261.07g/mol4-Bromo-3,5-dimethoxybenzoic acid
CAS:Formula:C9H9BrO4Purity:95%Color and Shape:SolidMolecular weight:261.0714-Bromo-3,5-dimethoxybenzoic acid
CAS:Controlled ProductApplications 4-Bromo-3,5-dimethoxybenzoic acid
Formula:C9H9BrO4Color and Shape:NeatMolecular weight:261.074-Bromo-3,5-dimethoxybenzoic acid
CAS:4-Bromo-3,5-dimethoxybenzoic acid is a synthetic molecule that has been shown to have catalytic properties. It was generated by the reaction of resorcinol and dimethoxybenzoic acid in the presence of copper(II) acetate. This compound has also been shown to be bioinspired by its similarity to natural products such as 3,5-dihydroxybenzoic acid. 4-Bromo-3,5-dimethoxybenzoic acid has been used for the synthesis of bioactive molecules with cyclic structures. These advances are important for sustainable development and may help in the discovery of new natural products.
Formula:C9H9BrO4Purity:Min. 95%Color and Shape:PowderMolecular weight:261.07 g/molRef: 3D-FB55410
Discontinued product







