CAS 565198-65-4

4-[(2,5-Dimethylphenyl)sulfonyl]-γ-oxo-1-piperazinebutanoic acid

Description:

4-[(2,5-Dimethylphenyl)sulfonyl]-γ-oxo-1-piperazinebutanoic acid, identified by its CAS number 565198-65-4, is a synthetic organic compound characterized by its complex structure, which includes a piperazine ring and a sulfonyl group. This compound typically exhibits properties associated with both acidic and basic functionalities due to the presence of the carboxylic acid group and the piperazine moiety. It is likely to be soluble in polar solvents, given the presence of the acidic group, while the aromatic sulfonyl group may contribute to its hydrophobic characteristics. The compound may also display biological activity, potentially acting as a pharmacophore in medicinal chemistry, although specific biological properties would depend on further empirical studies. Its molecular structure suggests potential applications in drug development, particularly in areas targeting central nervous system disorders or other therapeutic areas where piperazine derivatives are known to be effective. As with many synthetic compounds, safety and handling precautions should be observed due to potential toxicity or reactivity.

Formula: C₁₆H₂₂N₂O₅S

InChI: InChI=1S/C16H22N2O5S/c1-12-3-4-13(2)14(11-12)24(22,23)18-9-7-17(8-10-18)15(19)5-6-16(20)21/h3-4,11H,5-10H2,1-2H3,(H,20,21)

InChI key: InChIKey=CHVITORSKSQBLL-UHFFFAOYSA-N

SMILES: S(=O)(=O)(C1=C(C)C=CC(C)=C1)N2CCN(C(CCC(O)=O)=O)CC2

Synonyms:

• 4-[(2,5-Dimethylphenyl)sulfonyl]-γ-oxo-1-piperazinebutanoic acid
• 1-Piperazinebutanoic acid, 4-[(2,5-dimethylphenyl)sulfonyl]-γ-oxo-

4-[4-(2,5-Dimethylbenzenesulfonyl)piperazin-1-yl]-4-oxobutanoic acid

Controlled Product

CAS: 565198-65-4

4-[4-(2,5-Dimethylbenzenesulfonyl)piperazin-1-yl]-4-oxobutanoic acid is a research tool that is used as an activator for ion channels and ligand for receptor. It has a molecular weight of 459.06 g/mol, CAS No. 565198-65-4, and purity of ≥98%. This substance binds to the extracellular domain of the nicotinic acetylcholine receptor and modulates its function. Additionally, it interacts with other proteins such as antibody or peptides. 4-[4-(2,5-Dimethylbenzenesulfonyl)piperazin-1-yl]-4-oxobutanoic acid has been shown to inhibit the activity of protein kinase C (PKC), which plays a role in signal transduction pathways in cells.

Formula: C₁₆H₂₂N₂O₅S

Purity: Min. 95%

Molecular weight: 354.4 g/mol

Ref: 3D-QXA19865