CAS 565198-66-5

5-[(4-Ethylphenyl)amino]-1,3,4-thiadiazole-2(3H)-thione

Description:

5-[(4-Ethylphenyl)amino]-1,3,4-thiadiazole-2(3H)-thione is a chemical compound characterized by its thiadiazole core, which is a five-membered heterocyclic ring containing sulfur and nitrogen atoms. This compound features an ethylphenyl group attached to an amino group, contributing to its potential biological activity. The presence of the thione functional group (a sulfur atom double-bonded to a carbon atom) indicates that it may exhibit properties typical of thioketones, such as reactivity in nucleophilic substitution reactions. The compound's structure suggests it may have applications in pharmaceuticals or agrochemicals, particularly due to the presence of the aromatic ring, which can enhance lipophilicity and biological interactions. Additionally, the thiadiazole moiety is known for its diverse biological activities, including antimicrobial and anti-inflammatory properties. As with many organic compounds, its solubility, stability, and reactivity can be influenced by environmental factors such as pH and temperature. Safety and handling precautions should be observed, as with all chemical substances, to mitigate any potential hazards.

Formula: C₁₀H₁₁N₃S₂

InChI: InChI=1S/C10H11N3S2/c1-2-7-3-5-8(6-4-7)11-9-12-13-10(14)15-9/h3-6H,2H2,1H3,(H,11,12)(H,13,14)

InChI key: InChIKey=PWFZRTXZMYOYIB-UHFFFAOYSA-N

SMILES: N(C1=NNC(=S)S1)C2=CC=C(CC)C=C2

Synonyms:

• 1,3,4-Thiadiazole-2(3H)-thione, 5-[(4-ethylphenyl)amino]-
• 5-[(4-Ethylphenyl)amino]-1,3,4-thiadiazole-2(3H)-thione

5-[(4-Ethylphenyl)amino]-1,3,4-thiadiazole-2-thiol

CAS: 565198-66-5

Versatile small molecule scaffold

Formula: C₁₀H₁₁N₃S₂

Purity: Min. 95%

Molecular weight: 237.3 g/mol

Ref: 3D-QXA19866