CAS 5652-28-8
:2-Amino-3-phosphonopropionic acid
Description:
2-Amino-3-phosphonopropionic acid (AP3A) is a phosphonic acid derivative characterized by its amino and phosphonate functional groups. It is a white crystalline solid that is soluble in water, making it suitable for various biochemical applications. The compound features a three-carbon backbone with an amino group (-NH2) at one end and a phosphonate group (-PO3H2) at the other, which contributes to its acidic properties. AP3A is known for its role as a competitive inhibitor of certain enzymes, particularly those involved in the metabolism of amino acids and neurotransmitters. Its structural similarity to natural amino acids allows it to interact with biological systems, making it a valuable tool in research, particularly in studies related to neurobiology and metabolic pathways. Additionally, due to its phosphonate group, it can participate in various chemical reactions, including those involving phosphorylation. Overall, 2-Amino-3-phosphonopropionic acid is significant in both synthetic chemistry and biological research due to its unique properties and functional versatility.
Formula:C3H8NO5P
InChI:InChI=1S/C3H8NO5P/c4-2(3(5)6)1-10(7,8)9/h2H,1,4H2,(H,5,6)(H2,7,8,9)
InChI key:InChIKey=LBTABPSJONFLPO-UHFFFAOYSA-N
SMILES:C(CP(=O)(O)O)(C(O)=O)N
Synonyms:- (±)-2-Amino-3-phosphonopropanoic acid
- 2-Amino-3-phosphonopropionic acid
- 3-Phosphono-<span class="text-smallcaps">DL</span>-alanine
- 3-Phosphono-DL-alanine
- 3-Phosphonoalanine
- <span class="text-smallcaps">DL</span>-2-Amino-2-carboxyethylphosphonic acid
- <span class="text-smallcaps">DL</span>-2-Amino-3-phosphonopropionate
- <span class="text-smallcaps">DL</span>-2-Amino-3-phosphonopropionic acid
- DL-2-Amino-2-carboxyethylphosphonic acid
- DL-2-Amino-3-phosphonopropionate
- DL-2-Amino-3-phosphonopropionic acid
- Nsc 30078
- Phosphonic acid,(2-amino-2-carboxyethyl)-
- a-Amino-b-phosphonopropionicacid
- α-Amino-β-phosphonopropionic acid
- See more synonyms
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
(+-)-2-AMINO-3-PHOSPHONOPROPIONIC ACID ( AP-3)NMDA ANTAGONIST
CAS:Formula:C3H8NO5PPurity:98%Color and Shape:SolidMolecular weight:169.0731D,L-2-Amino-3-phosphonopropionic acid
CAS:D,L-2-Amino-3-phosphonopropionic acidPurity:≥95%Molecular weight:169.07g/molD,L-2-Amino-3-phosphonopropionic Acid
CAS:Controlled ProductApplications D,L-2-Amino-3-phosphonopropionic acid is a phosphonate substituted derivative of Aspartic acid (A788955) and is a known antagonist of a receptor that is coupled to phosphoinositide metabolism in brain slices. D,L-2-Amino-3-phosphonopropionic acid is also an inhibitor of metabotropic glutamate receptors in rat brain.
References Hedberg, T. & Stanton, P.: Eur. J. Pharma., 310, 19 (1996); Saugstad, J., et al.: Eur. J. Pharm.: Mol. Pharm., 289, 395 (1995); Schoepp, D., et al.: Mol. Pharm., 38, 222 (1990)Formula:C3H8NO5PColor and Shape:NeatMolecular weight:169.072-Amino-3-phosphonopropanoic acid
CAS:2-Amino-3-phosphonopropanoic acid is a chemical compound classified as a phosphonic acid derivative, which is obtained through synthetic processes in a laboratory setting. It acts as a selective antagonist of metabotropic glutamate receptors (mGluRs), specifically inhibiting the function of these receptors by blocking the normal action of the neurotransmitter glutamate, which is a critical excitatory neurotransmitter in the central nervous system. This blockade affects synaptic transmission and modulates neurological signals.Formula:C3H8NO5PPurity:Min. 95%Color and Shape:PowderMolecular weight:169.07 g/mol




