CAS 5652-32-4
:Thiocysteine
Description:
Thiocysteine, with the CAS number 5652-32-4, is a naturally occurring amino acid that is a sulfur-containing analog of cysteine. It features a thiol (-SH) group, which is characteristic of thiols and contributes to its reactivity and biological functions. Thiocysteine is known for its role in various biochemical processes, including protein synthesis and the regulation of redox states within cells. The presence of the thiol group allows thiocysteine to participate in disulfide bond formation and reduction, making it important in maintaining protein structure and function. Additionally, thiocysteine can act as an antioxidant, helping to protect cells from oxidative stress. Its solubility in water is typical of amino acids, and it can exist in different forms depending on the pH of the environment. Overall, thiocysteine is significant in both biological systems and potential therapeutic applications, particularly in the context of diseases related to oxidative damage.
Formula:C3H7NO2S2
InChI:InChI=1S/C3H7NO2S2/c4-2(1-8-7)3(5)6/h2,7H,1,4H2,(H,5,6)
InChI key:InChIKey=XBKONSCREBSMCS-UHFFFAOYSA-N
SMILES:C(CSS)(C(O)=O)N
Synonyms:- Thiocysteine
- Alanine, 3-(thiosulfeno)-
- 3-(Thiosulfeno)alanine
- 2-Amino-3-disulfanylpropanoic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
Thiocysteine
CAS:Thiocysteine is a cysteine derivative, activates aminolevulinate synthetase, used to study cysteine metabolism, and has anti-tumor properties.Formula:C3H7NO2S2Color and Shape:SolidMolecular weight:153.22

