CAS 56522-24-8
:tert-butyldimethylsilyl cyanide
Description:
Tert-butyldimethylsilyl cyanide, with the CAS number 56522-24-8, is a chemical compound that belongs to the class of silyl cyanides. It features a tert-butyldimethylsilyl group, which enhances its stability and reactivity in various chemical reactions. This compound is typically used as a protecting group for alcohols and amines in organic synthesis, allowing for selective reactions without interference from functional groups. It is characterized by its relatively low volatility and moderate solubility in organic solvents, making it suitable for various synthetic applications. The presence of the cyanide functional group imparts certain reactivity, enabling nucleophilic substitution reactions. Safety considerations are important when handling this compound, as cyanides are known to be toxic. Proper storage and handling protocols should be followed to mitigate risks. Overall, tert-butyldimethylsilyl cyanide is a valuable reagent in synthetic organic chemistry, particularly in the context of protecting group strategies and nucleophilic chemistry.
Formula:C7H15NSi
InChI:InChI=1/C7H15NSi/c1-7(2,3)9(4,5)6-8/h1-5H3
SMILES:CC(C)(C)[Si](C)(C)C#N
Synonyms:- t-Butyldimethylsilylnitrile
- Tert-Butyl(Dimethyl)Silanecarbonitrile
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
