
CAS 56522-51-1
:5-(2-Aminoethyl)-4-bromo-2-methoxyphenol
Description:
5-(2-Aminoethyl)-4-bromo-2-methoxyphenol, with the CAS number 56522-51-1, is an organic compound characterized by its phenolic structure, which includes a bromine atom and a methoxy group attached to the aromatic ring. The presence of the aminoethyl side chain contributes to its potential as a building block in pharmaceuticals and agrochemicals. This compound typically exhibits properties such as moderate solubility in polar solvents due to the hydroxyl and amino groups, while the bromine substituent may influence its reactivity and ability to participate in electrophilic substitution reactions. The methoxy group can also affect the electronic properties of the molecule, potentially enhancing its biological activity. Additionally, the compound may display antioxidant properties due to the presence of the phenolic hydroxyl group. As with many organic compounds, safety and handling precautions should be observed, as it may pose health risks if ingested or improperly handled. Overall, its unique structural features make it of interest in various chemical research and application fields.
Formula:C9H12BrNO2
InChI:InChI=1S/C9H12BrNO2/c1-13-9-5-7(10)6(2-3-11)4-8(9)12/h4-5,12H,2-3,11H2,1H3
InChI key:InChIKey=VATHVOGHZWSUTL-UHFFFAOYSA-N
SMILES:C(CN)C1=C(Br)C=C(OC)C(O)=C1
Synonyms:- Phenol, 5-(2-aminoethyl)-4-bromo-2-methoxy-
- 2-Bromo-5-hydroxy-4-methoxyphenethylamine
- 5-(2-Aminoethyl)-4-bromo-2-methoxyphenol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
