CAS 56523-47-8
:(R)-2-phenylpyrrolidine
Description:
(R)-2-phenylpyrrolidine is a chiral organic compound characterized by its pyrrolidine ring, which is a five-membered saturated nitrogen-containing heterocycle. The presence of a phenyl group at the second position of the pyrrolidine ring contributes to its unique properties and reactivity. This compound is typically a colorless to pale yellow liquid or solid, depending on its purity and form. It exhibits basicity due to the nitrogen atom in the ring, which can participate in hydrogen bonding and interact with various functional groups. (R)-2-phenylpyrrolidine is of interest in medicinal chemistry, particularly for its potential applications in drug development, as its chiral nature can influence biological activity and pharmacokinetics. Additionally, it may serve as a building block in the synthesis of more complex molecules. Its handling requires standard safety precautions, as with many organic compounds, to mitigate risks associated with exposure or reactivity.
Formula:C10H13N
InChI:InChI=1/C10H13N/c1-2-5-9(6-3-1)10-7-4-8-11-10/h1-3,5-6,10-11H,4,7-8H2/t10-/m1/s1
SMILES:c1ccc(cc1)[C@H]1CCCN1
Synonyms:- (2R)-2-Phenylpyrrolidine
- pyrrolidine, 2-phenyl-, (2R)-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
(R)-2-Phenylpyrrolidine
CAS:<p>(R)-2-Phenylpyrrolidine is a boronic ester that can be administered orally. It has been shown to have nootropic and memory-enhancing activities in rats, but it does not have any known effects on kinase activities, amines, factor receptors, or synthetic activity. (R)-2-Phenylpyrrolidine has also been shown to have prognostic value in cancer patients and can inhibit the growth of human cancer cells. This drug has been shown to bind to tropomyosin and growth factors with high affinity.</p>Formula:C10H13NPurity:Min. 95%Color and Shape:PowderMolecular weight:147.22 g/mol(R)-2-Phenylpyrrolidine
CAS:Controlled ProductFormula:C10H13NColor and Shape:NeatMolecular weight:147.217
