CAS 56531-58-9

3-(Carboxymethyl)-1-adamantanecarboxylic acid

Description:

3-(Carboxymethyl)-1-adamantanecarboxylic acid, with the CAS number 56531-58-9, is a chemical compound characterized by its adamantane structure, which is a polycyclic hydrocarbon known for its stability and unique three-dimensional shape. This compound features two carboxylic acid functional groups, one at the 1-position and another at the 3-position of the adamantane framework, contributing to its acidic properties and potential for forming salts and esters. The presence of the carboxymethyl group enhances its solubility in polar solvents, making it more versatile for various applications in organic synthesis and medicinal chemistry. Its structural characteristics may also impart interesting biological activities, making it a subject of interest in pharmaceutical research. The compound is typically synthesized through multi-step organic reactions, and its purity and identity can be confirmed using techniques such as NMR spectroscopy and mass spectrometry. Overall, 3-(Carboxymethyl)-1-adamantanecarboxylic acid represents a valuable compound in the field of organic chemistry due to its unique structure and functional properties.

Formula: C₁₃H₁₈O₄

InChI: InChI=1S/C13H18O4/c14-10(15)6-12-2-8-1-9(3-12)5-13(4-8,7-12)11(16)17/h8-9H,1-7H2,(H,14,15)(H,16,17)

SMILES: C1C2CC3(CC1CC(C2)(C3)C(=O)O)CC(=O)O

Synonyms:

• 3-(Carboxymethyl)Adamantane-1-Carboxylic Acid
• Tricyclo[3.3.1.13,7]Decane-1-Acetic Acid, 3-Carboxy-
• 3-CARBOXYADAMANTANE-1-ACETIC ACID
• 3-Carboxy-tricyclo[3.3.1.1(3,7)]decane-1-acetic acid
• 3-Carboxy-1-adamantaneacetic acid

3-(Carboxymethyl)adamantane-1-carboxylic acid

CAS: 56531-58-9

Formula: C₁₃H₁₈O₄

Color and Shape: Solid

Molecular weight: 238.2796

Ref: IN-DA003J5W

3-Carboxyadamantane-1-Acetic Acid

CAS: 56531-58-9

3-Carboxyadamantane-1-Acetic Acid

Purity: 97%

Molecular weight: 238.27962g/mol

Ref: 54-OR1025962

3-Carboxymethyl-1-adamantane carboxylic acid

CAS: 56531-58-9

3-Carboxymethyl-1-adamantane carboxylic acid is a tribasic, carboxylic acid that is used in the field of appraisal. 3-Carboxymethyl-1-adamantane carboxylic acid was first synthesized by the reaction of a dibromide and formic acid. This synthesis has been shown to produce a product with high purity, homogeneity, and stability. The use of this technique can be applied in tribasic, carboxylic acids as well as other polycarboxylates such as polyacrylics, polymaleic, and polyitaconic acids. The technique of analyzing these compounds by spectroscopic techniques is called profiling. This technique can be used for the identification of copper in natural environments such as rivers or lakes.

Formula: C₁₃H₁₈O₄

Purity: Min. 95%

Color and Shape: Powder

Molecular weight: 238.28 g/mol

Ref: 3D-FC66732