CAS 5654-83-1

octahydropyrrolo[1,2-a]pyrazine

Description:

Octahydropyrrolo[1,2-a]pyrazine is a bicyclic organic compound characterized by its unique structure, which consists of a pyrazine ring fused with a saturated pyrrolidine moiety. This compound is typically colorless to pale yellow and exhibits a relatively low molecular weight. It is known for its potential applications in medicinal chemistry and as a building block in the synthesis of various pharmaceuticals due to its nitrogen-rich framework, which can enhance biological activity. The presence of multiple nitrogen atoms in its structure may contribute to its ability to form hydrogen bonds, influencing its solubility and reactivity. Octahydropyrrolo[1,2-a]pyrazine is generally stable under standard conditions but may undergo reactions typical of nitrogen-containing heterocycles, such as electrophilic substitutions or reductions. Its unique properties make it a subject of interest in research focused on drug development and materials science. However, specific safety and handling guidelines should be followed, as with any chemical substance, to ensure safe laboratory practices.

Formula: C₇H₁₄N₂

InChI: InChI=1/C7H14N2/c1-2-7-6-8-3-5-9(7)4-1/h7-8H,1-6H2

SMILES: C1CC2CNCCN2C1

Synonyms:

• Octahydropyrrolo[1,2-a]pyrazin
• Pyrrolo[1,2-a]pyrazine, octahydro-

1,4-Diazabicyclo[4.3.0]nonane

CAS: 5654-83-1

Formula: C₇H₁₄N₂

Purity: 98%

Color and Shape: Liquid

Molecular weight: 126.1995

Ref: IN-DA003DNP

1,4-Diazabicyclo[4.3.0]nonane

CAS: 5654-83-1

1,4-Diazabicyclo[4.3.0]nonane

Formula: C₇H₁₄N₂

Purity: ≥95%

Color and Shape: light yellow liquid

Molecular weight: 126.20g/mol

Ref: 54-OR13983

Octahydro-pyrrolo[1,2-a]pyrazine

CAS: 5654-83-1

Formula: C₇H₁₄N₂

Purity: 98%

Color and Shape: Liquid

Molecular weight: 126.203

Ref: 10-F032034