CAS 56541-07-2

1-(2-Furfuryl)-2-thiourea

Description:

1-(2-Furfuryl)-2-thiourea, with the CAS number 56541-07-2, is an organic compound characterized by the presence of a thiourea functional group and a furfuryl moiety. This compound typically appears as a solid and is soluble in polar solvents due to its ability to form hydrogen bonds. The thiourea group imparts notable reactivity, allowing it to participate in various chemical reactions, including nucleophilic substitutions and condensation reactions. The furfuryl group, derived from furan, contributes to the compound's aromatic properties and can influence its biological activity. This substance has garnered interest in medicinal chemistry and materials science due to its potential applications, including as a building block in the synthesis of more complex molecules. Additionally, its unique structure may confer specific biological activities, making it a subject of research in pharmacology. Safety data should be reviewed before handling, as with all chemical substances, to ensure proper precautions are taken.

Formula: C₆H₈N₂OS

InChI: InChI=1/C6H8N2OS/c7-6(10)8-4-5-2-1-3-9-5/h1-3H,4H2,(H3,7,8,10)

SMILES: c1cc(CNC(=N)S)oc1

Synonyms:

• 1-(Furan-2-Ylmethyl)Thiourea

1-(2-FURFURYL)-2-THIOUREA

CAS: 56541-07-2

Formula: C₆H₈N₂OS

Purity: 95%

Color and Shape: Solid

Molecular weight: 156.2055

Ref: IN-DA00E9CY

1-(2-Furfuryl)-2-thiourea

CAS: 56541-07-2

1-(2-Furfuryl)-2-thiourea

Molecular weight: 156.20552g/mol

Ref: 54-OR1020805

1-(2-Furfuryl)-2-thiourea

CAS: 56541-07-2

Formula: C₆H₈N₂OS

Purity: 95%

Color and Shape: Solid

Molecular weight: 156.2

Ref: 10-F018703

1-(2-Furfuryl)-2-thiourea

CAS: 56541-07-2

1-(2-Furfuryl)-2-thiourea is a herbicidal compound that inhibits the growth of plants by interrupting the synthesis of chlorophyll. This reaction occurs through the formation of an intermediate called betacyanin, which absorbs light at 670 nm and prevents it from being used in photosynthesis. 1-(2-Furfuryl)-2-thiourea is synthesized through a two step process, starting with the condensation of phenylurea and thiourea. The second step involves the deuteriumation of 1-(2-furfuryl)thiourea to produce 1-(2-furfuryl)-2-thiourea. The deuteriumation process is achieved by reacting 1-(2-furfuryl)thiourea with sodium borohydride in methanol solution. The yield for this reaction is about 80%.

Formula: C₆H₈N₂OS

Purity: Min. 95%

Molecular weight: 156.2 g/mol

Ref: 3D-GCA54107