
CAS 565453-41-0
:L-Proline, N-(3-hydroxytricyclo[3.3.1.13,7]dec-1-yl)glycyl-, mono(trifluoroacetate) (salt)
Description:
L-Proline, N-(3-hydroxytricyclo[3.3.1.13,7]dec-1-yl)glycyl-, mono(trifluoroacetate) (salt) is a complex organic compound characterized by its unique structural features and functional groups. It contains an amino acid backbone, specifically proline, which is known for its role in protein synthesis and its cyclic structure that contributes to the stability of protein conformations. The presence of the trifluoroacetate moiety indicates that the compound is a salt, which can influence its solubility and reactivity. The tricyclic structure adds to the compound's rigidity and may impart specific biological activities or interactions. This compound is likely to exhibit properties typical of amino acids and their derivatives, such as being polar and potentially soluble in water, while the trifluoroacetate group may enhance its stability and influence its behavior in various chemical environments. Overall, this compound's unique structure suggests potential applications in pharmaceuticals or biochemistry, particularly in the development of peptide-based drugs or as a biochemical probe.
Formula:C17H26N2O4·C2HF3O2
InChI:InChI=1S/C17H26N2O4.C2HF3O2/c20-14(19-3-1-2-13(19)15(21)22)9-18-16-5-11-4-12(6-16)8-17(23,7-11)10-16;3-2(4,5)1(6)7/h11-13,18,23H,1-10H2,(H,21,22);(H,6,7)/t11?,12?,13-,16?,17?;/m0./s1
InChI key:InChIKey=ZYSYESQESYWANO-CSDSSYKASA-N
SMILES:N(CC(=O)N1[C@H](C(O)=O)CCC1)C23CC4(O)CC(C2)CC(C3)C4.C(C(O)=O)(F)(F)F
Synonyms:- L-Proline, N-(3-hydroxytricyclo[3.3.1.13,7]dec-1-yl)glycyl-, mono(trifluoroacetate) (salt)
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
Vildagliptin carboxylic acid metabolite (trifluoroacetate salt)
CAS:<p>Vildagliptin's main human metabolite inhibits DPP-4 (IC50: 477 μM) in Caco-2 cells, formed by cyano group hydrolysis.</p>Formula:C19H27F3N2O6Color and Shape:SolidMolecular weight:436.428Vildagliptin Impurity 3 Trifluoroacetate (Carboxy Acid Metabolite)
CAS:Formula:C17H26N2O4·C2HF3O2Color and Shape:White To Off-White SolidMolecular weight:322.41 114.02(2S)-1-[2-[(3-Hydroxy-1-adamantyl)amino]acetyl]pyrrolidine-2-carboxylic acid 2,2,2-trifluoroacetic acid
CAS:<p>(2S)-1-[2-[(3-Hydroxy-1-adamantyl)amino]acetyl]pyrrolidine-2-carboxylic acid 2,2,2-trifluoroacetic acid is an inhibitor that binds to the active site of protein kinase A (PKA). It is a noncompetitive inhibitor with a Ki of 0.03 μM for PKA. The inhibition of PKA by this drug has been shown to enhance the activation of glycogen synthase kinase 3β (GSK3β) and increase the phosphorylation of β-catenin at Ser33. This drug has also been shown to inhibit ion channels such as voltage gated sodium channels and calcium channels.</p>Formula:C19H27F3N2O6Purity:Min. 95%Molecular weight:436.4 g/molVildagliptin Impurity 3 (Trifluoroacetate)
CAS:Formula:C17H26N2O4C2HF3O2Molecular weight:322.41 : 114.02



