CAS 56548-51-7
:N'-(benzo[g]quinolin-4-yl)-N,N-diethylethane-1,2-diamine phosphate (1:2)
Description:
N'-(benzo[g]quinolin-4-yl)-N,N-diethylethane-1,2-diamine phosphate (1:2), with the CAS number 56548-51-7, is a chemical compound characterized by its complex structure, which includes a benzoquinoline moiety and a diethylamine group. This compound typically exhibits properties associated with both organic amines and phosphates, such as potential solubility in polar solvents and the ability to form hydrogen bonds. The presence of the benzoquinoline structure may impart unique optical and electronic properties, making it of interest in various applications, including pharmaceuticals and materials science. Additionally, the phosphate group suggests potential reactivity and interaction with biological systems, which could be relevant for drug design or biochemical studies. Its molecular interactions may also be influenced by the diethylamine substituents, which can affect its basicity and overall stability. Overall, this compound represents a fascinating intersection of organic chemistry and potential biological activity, warranting further investigation into its properties and applications.
Formula:C19H26N3O4P
InChI:InChI=1/C19H23N3.2H3O4P/c1-3-22(4-2)12-11-21-18-9-10-20-19-14-16-8-6-5-7-15(16)13-17(18)19;2*1-5(2,3)4/h5-10,13-14H,3-4,11-12H2,1-2H3,(H,20,21);2*(H3,1,2,3,4)
Synonyms:- dabechin
- dabequin
- G-800
- 1,2-Ethanediamine, N'-benzo(G)quinolin-4-yl-N,N-diethyl-, phosphate (1:2)
- C015773
- See more synonyms
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Dabequin
CAS:Dabequin is a derivative of aminoquinoline. It is said to have pharmacological activity against Plasmodium fukiparum.Formula:C19H29N3O8P2Color and Shape:SolidMolecular weight:489.4
