CAS 5655-01-6

3H-pyrrolo[3,2-d]pyrimidin-4(5H)-one

Description:

3H-pyrrolo[3,2-d]pyrimidin-4(5H)-one, with the CAS number 5655-01-6, is a heterocyclic organic compound characterized by its fused pyrrole and pyrimidine rings. This compound typically exhibits a planar structure, which contributes to its potential biological activity. It is known for its ability to participate in various chemical reactions, including those involving nucleophilic substitutions and cyclizations. The presence of the carbonyl group in the 4-position enhances its reactivity and can influence its interaction with biological targets. This compound has garnered interest in medicinal chemistry due to its potential as a scaffold for developing pharmaceuticals, particularly in the context of targeting specific enzymes or receptors. Additionally, its unique structural features may impart interesting electronic properties, making it a subject of study in materials science as well. Overall, 3H-pyrrolo[3,2-d]pyrimidin-4(5H)-one represents a versatile compound with implications in both synthetic and medicinal chemistry.

Formula: C₆H₅N₃O

InChI: InChI=1/C6H5N3O/c10-6-5-4(1-2-7-5)8-3-9-6/h1-3,7H,(H,8,9,10)

SMILES: c1c[nH]c2c1ncnc2O

Synonyms:

• 1,5-dihydro-4H-pyrrolo[3,2-d]pyrimidin-4-one
• Dihydro-4H-pyrrolo[3,2-d]pyrimidin-4-one, 1,5-

1H-Pyrrolo[3,2-d]pyrimidin-4(5H)-one

CAS: 5655-01-6

Formula: C₆H₅N₃O

Purity: 97%

Color and Shape: Solid

Molecular weight: 135.1234

Ref: IN-DA003JIW

1,5-Dihydro-4h-pyrrolo[3,2-d]pyrimidin-4-one

CAS: 5655-01-6

1,5-Dihydro-4h-pyrrolo[3,2-d]pyrimidin-4-one

Purity: 98%

Molecular weight: 135.12g/mol

Ref: 54-OR903256

1,5-Dihydro-4H-pyrrolo[3,2-d]pyrimidin-4-one

CAS: 5655-01-6

1,5-Dihydro-4H-pyrrolo[3,2-d]pyrimidin-4-one is a versatile building block that can be used in the synthesis of complex compounds and research chemicals. It is a very useful reagent that is widely used in pharmaceuticals and other chemical syntheses. The compound has been shown to be an effective scaffold for the synthesis of new drugs. 1,5-Dihydro-4H-pyrrolo[3,2-d]pyrimidin-4-one is a high quality, useful intermediate for the production of many different drugs.

Formula: C₆H₅N₃O

Purity: Min. 95%

Color and Shape: Powder

Molecular weight: 135.12 g/mol

Ref: 3D-FD153605

3H-Pyrrolo[3,2-d]pyrimidin-4(5H)-one

CAS: 5655-01-6

Formula: C₆H₅N₃O

Purity: 97%

Color and Shape: Solid

Molecular weight: 135.126

Ref: 10-F064480