CAS 5657-20-5

α-[(2-Furanylcarbonyl)amino]benzeneacetic acid

Description:

α-[(2-Furanylcarbonyl)amino]benzeneacetic acid, with the CAS number 5657-20-5, is an organic compound characterized by its unique structure that combines a furan ring with an amino acid derivative. This compound features a benzeneacetic acid backbone, which is substituted at the alpha position with a 2-furanylcarbonylamino group. The presence of the furan moiety contributes to its potential reactivity and biological activity, as furan derivatives are known for their diverse pharmacological properties. The compound is likely to exhibit both acidic and basic characteristics due to the carboxylic acid group and the amino group, respectively. Its solubility may vary depending on the pH of the solution, and it may participate in various chemical reactions, including acylation and amide formation. Additionally, the compound's structural features suggest potential applications in medicinal chemistry, particularly in the development of pharmaceuticals targeting specific biological pathways. Overall, α-[(2-Furanylcarbonyl)amino]benzeneacetic acid represents a compound of interest for further research in organic synthesis and drug development.

Formula: C₁₃H₁₁NO₄

InChI: InChI=1S/C13H11NO4/c15-12(10-7-4-8-18-10)14-11(13(16)17)9-5-2-1-3-6-9/h1-8,11H,(H,14,15)(H,16,17)

InChI key: InChIKey=BAIPGCMVKIAUJL-UHFFFAOYSA-N

SMILES: C(NC(=O)C1=CC=CO1)(C(O)=O)C2=CC=CC=C2

Synonyms:

• α-[(2-Furanylcarbonyl)amino]benzeneacetic acid
• Benzeneacetic acid, α-[(2-furanylcarbonyl)amino]-
• (Furan-2-carbonylamino)-phenyl-acetic acid
• 2-(Furan-2-ylformamido)-2-phenylacetic acid
• Glycine, N-2-furoyl-2-phenyl-

2-(Furan-2-ylformamido)-2-phenylacetic acid

CAS: 5657-20-5

Versatile small molecule scaffold

Formula: C₁₃H₁₁NO₄

Purity: Min. 95%

Molecular weight: 245.23 g/mol

Ref: 3D-FAA65720