CAS 5657-41-0

4-(carbamoylamino)benzenesulfonamide

Description:

4-(Carbamoylamino)benzenesulfonamide, also known as sulfanilamide, is an organic compound characterized by its sulfonamide functional group attached to a benzene ring. This compound features a carbamoylamino group, which contributes to its solubility and reactivity. It typically appears as a white to off-white crystalline solid and is soluble in water, reflecting its polar nature due to the presence of both sulfonamide and amide functionalities. The compound exhibits properties typical of sulfonamides, including antibacterial activity, which is attributed to its ability to inhibit bacterial folic acid synthesis. Its molecular structure allows for hydrogen bonding, enhancing its interactions in biological systems. Additionally, it may undergo various chemical reactions, such as acylation or alkylation, making it a versatile intermediate in organic synthesis. Safety data indicates that it should be handled with care, as it may cause irritation upon contact with skin or eyes. Overall, 4-(carbamoylamino)benzenesulfonamide is significant in medicinal chemistry and pharmaceutical applications.

Formula: C₇H₉N₃O₃S

InChI: InChI=1/C7H9N3O3S/c8-7(11)10-5-1-3-6(4-2-5)14(9,12)13/h1-4H,(H3,8,10,11)(H2,9,12,13)

SMILES: c1cc(ccc1NC(=N)O)S(=O)(=O)N

(4-Sulfamoylphenyl)urea

CAS: 5657-41-0

4-Sulfamoylphenyl urea is a molecule that is used in the treatment of cancer. It has been shown to inhibit the growth of pancreatic and colon cancer cells by interfering with their ability to use glucose, which is a major source of energy for these cells. 4-Sulfamoylphenyl urea also inhibits the production of carbonic anhydrase enzymes, which are needed for cellular respiration and lead to cell death. This drug has been shown to have anti-metastatic effects in vivo and in vitro, which may be due to its ability to inhibit protein synthesis.

Formula: C₇H₉N₃O₃S

Purity: Min. 95%

Molecular weight: 215.23 g/mol

Ref: 3D-FAA65741