CAS 5657-70-5
:1-methylpiperidine-3-carboxylic acid
Description:
1-Methylpiperidine-3-carboxylic acid is an organic compound characterized by its piperidine ring structure, which is a six-membered saturated nitrogen-containing heterocycle. This compound features a methyl group attached to the nitrogen atom of the piperidine ring and a carboxylic acid functional group at the 3-position of the ring. It is a colorless to pale yellow liquid or solid, depending on the temperature and purity. The presence of the carboxylic acid group imparts acidic properties, allowing it to participate in various chemical reactions, such as esterification and amidation. Additionally, the compound is soluble in polar solvents like water and alcohols, which is typical for carboxylic acids. Its structure allows for potential applications in pharmaceuticals and organic synthesis, particularly in the development of biologically active compounds. Safety data indicates that, like many organic acids, it should be handled with care to avoid skin and eye irritation.
Formula:C7H13NO2
InChI:InChI=1/C7H13NO2/c1-8-4-2-3-6(5-8)7(9)10/h6H,2-5H2,1H3,(H,9,10)
SMILES:CN1CCCC(C1)C(=O)O
Synonyms:- 3-Piperidinecarboxylic Acid, 1-Methyl-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
3-Piperidinecarboxylic acid, 1-methyl-
CAS:Formula:C7H13NO2Purity:97%Color and Shape:SolidMolecular weight:143.18361-Methylpiperidine-3-carboxylic acid
CAS:1-Methylpiperidine-3-carboxylic acidFormula:C7H13NO2Purity:≥95%Color and Shape: white to off-white solidMolecular weight:143.18g/mol1-Methyl-piperidine-3-carboxylic acid
CAS:Formula:C7H13NO2Purity:97%Color and Shape:SolidMolecular weight:143.1861-Methylpiperidine-3-carboxylic acid
CAS:<p>1-Methylpiperidine-3-carboxylic acid (1MP) is a neurotoxic compound that can be synthesized in vivo by the oxidation of choline. It has been shown to have a natriuretic and diuretic effect on the kidney, as well as stimulating the release of atrial natriuretic peptide. 1MP also has an agonistic effect on the dopamine receptors, and is a competitive antagonist for the binding of betaines to skin cells. Betaines are substances that are found in many foods, including wheat germ and spinach, which have been linked to nerve cell death in rats.<br>END>></p>Formula:C7H13NO2Purity:Min. 95%Molecular weight:143.19 g/mol



