CAS 56581-76-1

7-hydroxy-3-(4-hydroxy-2-methoxy-phenyl)chromen-4-one

Description:

7-Hydroxy-3-(4-hydroxy-2-methoxy-phenyl)chromen-4-one, also known by its CAS number 56581-76-1, is a flavonoid compound characterized by its chromone backbone, which is a fused benzopyran structure. This compound features multiple hydroxyl groups and a methoxy group, contributing to its potential antioxidant properties. The presence of these functional groups enhances its ability to scavenge free radicals and may provide various health benefits. It is often studied for its biological activities, including anti-inflammatory, antimicrobial, and anticancer effects. The compound's solubility and stability can vary depending on the solvent and environmental conditions, which is important for its application in pharmaceuticals and nutraceuticals. Additionally, its structural features allow for interactions with various biological targets, making it a subject of interest in medicinal chemistry and natural product research. Overall, 7-hydroxy-3-(4-hydroxy-2-methoxy-phenyl)chromen-4-one exemplifies the diverse roles that flavonoids can play in both nature and potential therapeutic applications.

Formula: C₁₆H₁₂O₅

InChI: InChI=1/C16H12O5/c1-20-14-6-9(17)2-4-11(14)13-8-21-15-7-10(18)3-5-12(15)16(13)19/h2-8,17-18H,1H3

SMILES: COc1cc(ccc1c1coc2cc(ccc2c1=O)O)O

4',7-Dihydroxy-2-methoxyisoflavone

CAS: 56581-76-1

4',7-Dihydroxy-2-methoxyisoflavone is a naturally occurring isoflavone, which is a type of phytochemical compound typically found in the Leguminosae family of plants. These plants are well-known for their rich source of bioactive compounds. This specific isoflavone is primarily isolated from plants like red clover or soybeans, which are renowned for their beneficial bioactive constituents.

Formula: C₁₆H₁₂O₅

Purity: Min. 95%

Molecular weight: 284.26 g/mol

Ref: 3D-FD69742