CAS 56583-49-4

2-(pyridin-2-yl)-3H-indol-3-one 1-oxide 4-methylbenzenesulfonate (1:1)

Description:

2-(Pyridin-2-yl)-3H-indol-3-one 1-oxide 4-methylbenzenesulfonate (1:1), with CAS number 56583-49-4, is a chemical compound characterized by its complex structure, which includes an indole moiety and a pyridine ring. This compound typically exhibits properties associated with both indole and pyridine derivatives, such as potential biological activity and solubility in organic solvents. The presence of the sulfonate group enhances its solubility in polar solvents, making it suitable for various applications in medicinal chemistry and biochemistry. The compound may also display interesting photophysical properties due to the presence of the indole and pyridine systems, which can participate in electronic transitions. Additionally, it may have implications in drug development, particularly in targeting specific biological pathways. Its stability, reactivity, and interaction with biological systems would depend on the specific functional groups and their arrangement within the molecule. Overall, this compound represents a unique combination of structural features that could be explored for various scientific and industrial applications.

Formula: C₂₀H₁₆N₂O₅S

InChI: InChI=1/C13H8N2O2.C7H8O3S/c16-13-9-5-1-2-7-11(9)15(17)12(13)10-6-3-4-8-14-10;1-6-2-4-7(5-3-6)11(8,9)10/h1-8H;2-5H,1H3,(H,8,9,10)

SMILES: c1ccc2c(c1)C(=O)C(=N2=O)c1ccccn1

Synonyms:

• 2-(2-pyridyl)-3H-indol-3-one N-oxide
• 3H-Indol-3-one, 2-(2-pyridinyl)-, 1-oxide
• 3H-Indol-3-one, 2-(2-pyridinyl)-, 1-oxide, 4-methylbenzenesulfonate (1:1)
• 2-(Pyridin-2-yl)-3H-indol-3-one 1-oxide 4-methylbenzenesulfonate (1:1)

PIT

CAS: 56583-49-4

PIT (2,2'-Pyridylisatogen tosylate) is a specific and non-competitive antagonist of the Purinergic receptor P2Y1 with an IC50 of 0.14 μM for human P2Y1.

Formula: C₂₀H₁₆N₂O₅S

Purity: 98.63%

Color and Shape: Solid

Molecular weight: 396.42

Ref: TM-T23164

3-Oxo-2-(pyridin-2-yl)-3H-indole 1-oxide 4-methylbenzenesulfonate

CAS: 56583-49-4

Formula: C₂₀H₁₆N₂O₅S

Purity: 98%

Molecular weight: 396.4164

Ref: IN-DA00EGNQ

PIT

CAS: 56583-49-4

PIT

Purity: ≥98%

Molecular weight: 396.42g/mol

Ref: 54-BUP06806

2,2'-Pyridylisatogen Tosylate

Controlled Product

CAS: 56583-49-4

Formula: C₁₃H₈N₂O₂·C₇H₈O₃S

Color and Shape: Neat

Molecular weight: 396.416

Ref: TR-P475253