CymitQuimica logo

CAS 5659-81-4

:

4,6-bis(methylsulfanyl)hexanoic acid

Description:
4,6-bis(methylsulfanyl)hexanoic acid, with the CAS number 5659-81-4, is an organic compound characterized by its hexanoic acid backbone, which is a six-carbon fatty acid. The presence of two methylsulfanyl (–S(CH3)2) groups at the 4 and 6 positions of the hexanoic chain significantly influences its chemical properties. This compound is likely to exhibit both hydrophobic and hydrophilic characteristics due to the long hydrocarbon chain and the polar sulfanyl groups, making it amphiphilic. It may participate in various chemical reactions typical of carboxylic acids, such as esterification and amidation. The methylsulfanyl groups can also impart unique reactivity, potentially allowing for nucleophilic substitution reactions. Additionally, the compound may have applications in organic synthesis, particularly in the development of surfactants or as intermediates in the synthesis of more complex molecules. Its physical properties, such as solubility and melting point, would depend on the balance between the hydrophobic hexanoic chain and the polar methylsulfanyl groups.
Formula:C8H16O2S2
InChI:InChI=1/C8H16O2S2/c1-11-6-5-7(12-2)3-4-8(9)10/h7H,3-6H2,1-2H3,(H,9,10)
SMILES:CSCCC(CCC(=O)O)SC
Synonyms:
  • Hexanoic Acid, 4,6-Bis(Methylthio)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.