CAS 56594-87-7
:D-Fructose, 1,6-bis(dihydrogen phosphate), compd. with cyclohexanamine (1:4)
Description:
D-Fructose, 1,6-bis(dihydrogen phosphate), compound with cyclohexanamine (1:4) is a chemical compound characterized by its structure, which includes a fructose molecule modified with two phosphate groups at the 1 and 6 positions, and complexed with cyclohexanamine. This compound is typically involved in biochemical processes, particularly in energy metabolism and cellular signaling. The presence of phosphate groups suggests it may play a role in phosphorylation reactions, which are crucial for various metabolic pathways. Cyclohexanamine, a cyclic amine, contributes to the compound's solubility and stability in aqueous environments. The compound may exhibit properties such as being hygroscopic and having a specific pH range, which can influence its reactivity and interaction with other biological molecules. Its CAS number, 56594-87-7, allows for precise identification in chemical databases. Overall, this compound is of interest in both biochemical research and potential applications in pharmaceuticals or nutrition due to its involvement in metabolic processes.
Formula:C6H14O12P2·4C6H13N
InChI:InChI=1S/C6H13N.C6H14O12P2/c7-6-4-2-1-3-5-6;7-3(1-17-19(11,12)13)5(9)6(10)4(8)2-18-20(14,15)16/h6H,1-5,7H2;3,5-7,9-10H,1-2H2,(H2,11,12,13)(H2,14,15,16)/t;3-,5-,6-/m.1/s1
InChI key:InChIKey=QTCBLNIYFLISQP-HLSXMHAQSA-N
SMILES:[C@H]([C@@H](C(COP(=O)(O)O)=O)O)([C@@H](COP(=O)(O)O)O)O.NC1CCCCC1
Synonyms:- 1,6-Bis(dihydrogen phosphate) <span class="text-smallcaps">D</span>-fructofuranose compd. with cyclohexanamine (1:4)
- <span class="text-smallcaps">D</span>-Fructose, 1,6-bis(dihydrogen phosphate), compd. with cyclohexanamine (1:4)
- cyclohexanamine - 1,6-di-O-phosphono-D-fructose (1:1)
- 1,6-Bis(dihydrogen phosphate) D-fructofuranose compd. with cyclohexanamine (1:4)
- D-Fructose, 1,6-bis(dihydrogen phosphate), compd. with cyclohexanamine (1:4)
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
D-Fructose 1,6-bisphosphate tetra(cyclohexylammonium) salt
CAS:Formula:C6H14O12P2·4C6H13NMolecular weight:736.81D-Fructose-1,6-diphosphate tetra(cyclohexylammonium) salt
CAS:<p>D-Fructose-1,6-diphosphate tetra(cyclohexylammonium) salt is a white to off-white crystalline powder. It is soluble in water and ethanol and insoluble in ether, chloroform, and benzene. D-Fructose-1,6-diphosphate tetra(cyclohexylammonium) salt is used as a raw material for the production of mono and oligosaccharides by click chemistry or glycosylation. The chemical formula for this substance is CHNO4.H2O4C8H11N.</p>Formula:C6H14O12P2·4C6H13NPurity:Min. 95%Molecular weight:736.81 g/mol

